C20H16F3NO5S — CID 46907093
(5Z)-5-[(4-phenylmethoxyphenyl)methylidene]-3-(3,3,3-trifluoro-2,2-dihydroxypropyl)-1,3-thiazolidine-2,4-dione (PubChem CID 46907093) has the molecular formula C20H16F3NO5S and a molecular weight of 439.41 g/mol. Its IUPAC name is (5Z)-5-[(4-phenylmethoxyphenyl)methylidene]-3-(3,3,3-trifluoro-2,2-dihydroxypropyl)-1,3-thiazolidine-2,4-dione.
| Compound Name | (5Z)-5-[(4-phenylmethoxyphenyl)methylidene]-3-(3,3,3-trifluoro-2,2-dihydroxypropyl)-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 46907093 |
| Molecular Formula | C20H16F3NO5S |
| Molecular Weight | 439.41 g/mol |
| Exact Mass | 439.07 |
| IUPAC Name | (5Z)-5-[(4-phenylmethoxyphenyl)methylidene]-3-(3,3,3-trifluoro-2,2-dihydroxypropyl)-1,3-thiazolidine-2,4-dione |
| SMILES | O=C1S/C(=C\c2ccc(OCc3ccccc3)cc2)C(=O)N1CC(O)(O)C(F)(F)F |
| InChI | InChI=1S/C20H16F3NO5S/c21-20(22,23)19(27,28)12-24-17(25)16(30-18(24)26)10-13-6-8-15(9-7-13)29-11-14-4-2-1-3-5-14/h1-10,27-28H,11-12H2/b16-10- |
| InChIKey | VIWLVBGNKUWTDL-YBEGLDIGSA-N |
| XLogP | 3.55 |
| TPSA | 87.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.41 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|