C19H25NS2 — CID 46907097
N-ethyl-1,3-bis(4-methylsulfanylphenyl)propan-2-amine (PubChem CID 46907097) has the molecular formula C19H25NS2 and a molecular weight of 331.55 g/mol. Its IUPAC name is N-ethyl-1,3-bis(4-methylsulfanylphenyl)propan-2-amine.
| Compound Name | N-ethyl-1,3-bis(4-methylsulfanylphenyl)propan-2-amine |
|---|---|
| PubChem CID | 46907097 |
| Molecular Formula | C19H25NS2 |
| Molecular Weight | 331.55 g/mol |
| Exact Mass | 331.14 |
| IUPAC Name | N-ethyl-1,3-bis(4-methylsulfanylphenyl)propan-2-amine |
| SMILES | CCNC(Cc1ccc(SC)cc1)Cc1ccc(SC)cc1 |
| InChI | InChI=1S/C19H25NS2/c1-4-20-17(13-15-5-9-18(21-2)10-6-15)14-16-7-11-19(22-3)12-8-16/h5-12,17,20H,4,13-14H2,1-3H3 |
| InChIKey | XHOIEIYFFBEJMP-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.55 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |