C15H23NO3 — CID 4690722
6-[(2-methylcyclohexyl)carbamoyl]cyclohex-3-ene-1-carboxylic acid (PubChem CID 4690722) has the molecular formula C15H23NO3 and a molecular weight of 265.35 g/mol. Its IUPAC name is 6-[(2-methylcyclohexyl)carbamoyl]cyclohex-3-ene-1-carboxylic acid.
| Compound Name | 6-[(2-methylcyclohexyl)carbamoyl]cyclohex-3-ene-1-carboxylic acid |
|---|---|
| PubChem CID | 4690722 |
| Molecular Formula | C15H23NO3 |
| Molecular Weight | 265.35 g/mol |
| Exact Mass | 265.17 |
| IUPAC Name | 6-[(2-methylcyclohexyl)carbamoyl]cyclohex-3-ene-1-carboxylic acid |
| SMILES | CC1CCCCC1NC(=O)C1CC=CCC1C(=O)O |
| InChI | InChI=1S/C15H23NO3/c1-10-6-2-5-9-13(10)16-14(17)11-7-3-4-8-12(11)15(18)19/h3-4,10-13H,2,5-9H2,1H3,(H,16,17)(H,18,19) |
| InChIKey | HQGJKFJOZCPTLE-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.35 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|