C16H12N2O2 — CID 46907248
14-(2-hydroxyethyl)-14,15-diazatetracyclo[7.6.1.02,7.013,16]hexadeca-1(15),2,4,6,9(16),10,12-heptaen-8-one (PubChem CID 46907248) has the molecular formula C16H12N2O2 and a molecular weight of 264.28 g/mol. Its IUPAC name is 14-(2-hydroxyethyl)-14,15-diazatetracyclo[7.6.1.02,7.013,16]hexadeca-1(15),2,4,6,9(16),10,12-heptaen-8-one.
| Compound Name | 14-(2-hydroxyethyl)-14,15-diazatetracyclo[7.6.1.02,7.013,16]hexadeca-1(15),2,4,6,9(16),10,12-heptaen-8-one |
|---|---|
| PubChem CID | 46907248 |
| Molecular Formula | C16H12N2O2 |
| Molecular Weight | 264.28 g/mol |
| Exact Mass | 264.09 |
| IUPAC Name | 14-(2-hydroxyethyl)-14,15-diazatetracyclo[7.6.1.02,7.013,16]hexadeca-1(15),2,4,6,9(16),10,12-heptaen-8-one |
| SMILES | O=C1c2ccccc2-c2nn(CCO)c3cccc1c23 |
| InChI | InChI=1S/C16H12N2O2/c19-9-8-18-13-7-3-6-12-14(13)15(17-18)10-4-1-2-5-11(10)16(12)20/h1-7,19H,8-9H2 |
| InChIKey | IWTWHJYONHLOQB-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.28 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |