C16H13N3O — CID 46907250
14-(2-aminoethyl)-14,15-diazatetracyclo[7.6.1.02,7.013,16]hexadeca-1(15),2,4,6,9(16),10,12-heptaen-8-one (PubChem CID 46907250) has the molecular formula C16H13N3O and a molecular weight of 263.30 g/mol. Its IUPAC name is 14-(2-aminoethyl)-14,15-diazatetracyclo[7.6.1.02,7.013,16]hexadeca-1(15),2,4,6,9(16),10,12-heptaen-8-one.
| Compound Name | 14-(2-aminoethyl)-14,15-diazatetracyclo[7.6.1.02,7.013,16]hexadeca-1(15),2,4,6,9(16),10,12-heptaen-8-one |
|---|---|
| PubChem CID | 46907250 |
| Molecular Formula | C16H13N3O |
| Molecular Weight | 263.30 g/mol |
| Exact Mass | 263.11 |
| IUPAC Name | 14-(2-aminoethyl)-14,15-diazatetracyclo[7.6.1.02,7.013,16]hexadeca-1(15),2,4,6,9(16),10,12-heptaen-8-one |
| SMILES | NCCn1nc2c3c(cccc31)C(=O)c1ccccc1-2 |
| InChI | InChI=1S/C16H13N3O/c17-8-9-19-13-7-3-6-12-14(13)15(18-19)10-4-1-2-5-11(10)16(12)20/h1-7H,8-9,17H2 |
| InChIKey | BELLEOUYTCSNAZ-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 60.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.30 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |