About 9-butyl-1-methyl-2H-pyrido[3,4-b]indol-7-one;hydrobromide
9-butyl-1-methyl-2H-pyrido[3,4-b]indol-7-one;hydrobromide (PubChem CID 46907334) has the molecular formula C16H19BrN2O
and a molecular weight of 335.25 g/mol. Its IUPAC name is 9-butyl-1-methyl-2H-pyrido[3,4-b]indol-7-one;hydrobromide.
Molecular Properties
| Compound Name | 9-butyl-1-methyl-2H-pyrido[3,4-b]indol-7-one;hydrobromide |
| PubChem CID | 46907334 |
| Molecular Formula | C16H19BrN2O |
| Molecular Weight | 335.25 g/mol |
| Exact Mass | 334.07 |
| IUPAC Name | 9-butyl-1-methyl-2H-pyrido[3,4-b]indol-7-one;hydrobromide |
| SMILES | Br.CCCCn1c2cc(=O)ccc2c2cc[nH]c(C)c21 |
| InChI | InChI=1S/C16H18N2O.BrH/c1-3-4-9-18-15-10-12(19)5-6-13(15)14-7-8-17-11(2)16(14)18;/h5-8,10,17H,3-4,9H2,1-2H3;1H |
| InChIKey | XSUGLNDHWGEBJX-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 37.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 335.25 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 9-butyl-1-methyl-2H-pyrido[3,4-b]indol-7-one;hydrobromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-butyl-1-methyl-2H-pyrido[3,4-b]indol-7-one;hydrobromide?
The IUPAC name of 9-butyl-1-methyl-2H-pyrido[3,4-b]indol-7-one;hydrobromide (CID 46907334) is 9-butyl-1-methyl-2H-pyrido[3,4-b]indol-7-one;hydrobromide.
What is the SMILES notation for 9-butyl-1-methyl-2H-pyrido[3,4-b]indol-7-one;hydrobromide?
The canonical SMILES for 9-butyl-1-methyl-2H-pyrido[3,4-b]indol-7-one;hydrobromide is Br.CCCCn1c2cc(=O)ccc2c2cc[nH]c(C)c21.
What is the InChIKey of 9-butyl-1-methyl-2H-pyrido[3,4-b]indol-7-one;hydrobromide?
The InChIKey is XSUGLNDHWGEBJX-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H18N2O.BrH/c1-3-4-9-18-15-10-12(19)5-6-13(15)14-7-8-17-11(2)16(14)18;/h5-8,10,17H,3-4,9H2,1-2H3;1H.
What are the key properties of 9-butyl-1-methyl-2H-pyrido[3,4-b]indol-7-one;hydrobromide?
9-butyl-1-methyl-2H-pyrido[3,4-b]indol-7-one;hydrobromide has a molecular weight of 335.25 g/mol, XLogP of 4.17, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 9-butyl-1-methyl-2H-pyrido[3,4-b]indol-7-one;hydrobromide is sourced from PubChem (CID 46907334), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).