C36H52O13 — CID 46907545
[(2R,3R,4S,5R,6S)-6-[[(1R,7aR)-7-ethyl-3,5-dioxo-1,7a-dihydrocyclopenta[c]pyran-1-yl]oxy]-3,4,5-tris(2,2-dimethylpropanoyloxy)oxan-2-yl]methyl 2,2-dimethylpropanoate (PubChem CID 46907545) has the molecular formula C36H52O13 and a molecular weight of 692.80 g/mol. Its IUPAC name is [(2R,3R,4S,5R,6S)-6-[[(1R,7aR)-7-ethyl-3,5-dioxo-1,7a-dihydrocyclopenta[c]pyran-1-yl]oxy]-3,4,5-tris(2,2-dimethylpropanoyloxy)oxan-2-yl]methyl 2,2-dimethylpropanoate.
| Compound Name | [(2R,3R,4S,5R,6S)-6-[[(1R,7aR)-7-ethyl-3,5-dioxo-1,7a-dihydrocyclopenta[c]pyran-1-yl]oxy]-3,4,5-tris(2,2-dimethylpropanoyloxy)oxan-2-yl]methyl 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 46907545 |
| Molecular Formula | C36H52O13 |
| Molecular Weight | 692.80 g/mol |
| Exact Mass | 692.34 |
| IUPAC Name | [(2R,3R,4S,5R,6S)-6-[[(1R,7aR)-7-ethyl-3,5-dioxo-1,7a-dihydrocyclopenta[c]pyran-1-yl]oxy]-3,4,5-tris(2,2-dimethylpropanoyloxy)oxan-2-yl]methyl 2,2-dimethylpropanoate |
| SMILES | CCC1=CC(=O)C2=CC(=O)O[C@@H](O[C@@H]3O[C@H](COC(=O)C(C)(C)C)[C@@H](OC(=O)C(C)(C)C)[C@H](OC(=O)C(C)(C)C)[C@H]3OC(=O)C(C)(C)C)[C@H]12 |
| InChI | InChI=1S/C36H52O13/c1-14-18-15-20(37)19-16-22(38)45-27(23(18)19)49-28-26(48-32(42)36(11,12)13)25(47-31(41)35(8,9)10)24(46-30(40)34(5,6)7)21(44-28)17-43-29(39)33(2,3)4/h15-16,21,23-28H,14,17H2,1-13H3/t21-,23-,24-,25+,26-,27+,28+/m1/s1 |
| InChIKey | DUYDAXPDYNBAEH-PJJPLJHPSA-N |
| XLogP | 4.54 |
| TPSA | 167.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 692.80 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|