C32H48O10 — CID 46907546
[(2R,3R,4S,5R,6S)-6-[[(1R,7aR)-7-ethyl-3-oxo-5,7a-dihydro-1H-cyclopenta[c]pyran-1-yl]oxy]-4,5-bis(2,2-dimethylpropanoyloxy)-2-ethyloxan-3-yl] 2,2-dimethylpropanoate (PubChem CID 46907546) has the molecular formula C32H48O10 and a molecular weight of 592.73 g/mol. Its IUPAC name is [(2R,3R,4S,5R,6S)-6-[[(1R,7aR)-7-ethyl-3-oxo-5,7a-dihydro-1H-cyclopenta[c]pyran-1-yl]oxy]-4,5-bis(2,2-dimethylpropanoyloxy)-2-ethyloxan-3-yl] 2,2-dimethylpropanoate.
| Compound Name | [(2R,3R,4S,5R,6S)-6-[[(1R,7aR)-7-ethyl-3-oxo-5,7a-dihydro-1H-cyclopenta[c]pyran-1-yl]oxy]-4,5-bis(2,2-dimethylpropanoyloxy)-2-ethyloxan-3-yl] 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 46907546 |
| Molecular Formula | C32H48O10 |
| Molecular Weight | 592.73 g/mol |
| Exact Mass | 592.32 |
| IUPAC Name | [(2R,3R,4S,5R,6S)-6-[[(1R,7aR)-7-ethyl-3-oxo-5,7a-dihydro-1H-cyclopenta[c]pyran-1-yl]oxy]-4,5-bis(2,2-dimethylpropanoyloxy)-2-ethyloxan-3-yl] 2,2-dimethylpropanoate |
| SMILES | CCC1=CCC2=CC(=O)O[C@@H](O[C@@H]3O[C@H](CC)[C@@H](OC(=O)C(C)(C)C)[C@H](OC(=O)C(C)(C)C)[C@H]3OC(=O)C(C)(C)C)[C@H]12 |
| InChI | InChI=1S/C32H48O10/c1-12-17-14-15-18-16-20(33)38-25(21(17)18)42-26-24(41-29(36)32(9,10)11)23(40-28(35)31(6,7)8)22(19(13-2)37-26)39-27(34)30(3,4)5/h14,16,19,21-26H,12-13,15H2,1-11H3/t19-,21-,22-,23+,24-,25+,26+/m1/s1 |
| InChIKey | PWQNPLYWAQROEZ-JEWHCNPPSA-N |
| XLogP | 5.18 |
| TPSA | 123.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.73 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|