About 4-[6-amino-8-[(2,5-dimethoxyphenyl)methyl]-2-methylpurin-9-yl]butanenitrile
4-[6-amino-8-[(2,5-dimethoxyphenyl)methyl]-2-methylpurin-9-yl]butanenitrile (PubChem CID 46907556) has the molecular formula C19H22N6O2
and a molecular weight of 366.43 g/mol. Its IUPAC name is 4-[6-amino-8-[(2,5-dimethoxyphenyl)methyl]-2-methylpurin-9-yl]butanenitrile.
Molecular Properties
| Compound Name | 4-[6-amino-8-[(2,5-dimethoxyphenyl)methyl]-2-methylpurin-9-yl]butanenitrile |
| PubChem CID | 46907556 |
| Molecular Formula | C19H22N6O2 |
| Molecular Weight | 366.43 g/mol |
| Exact Mass | 366.18 |
| IUPAC Name | 4-[6-amino-8-[(2,5-dimethoxyphenyl)methyl]-2-methylpurin-9-yl]butanenitrile |
| SMILES | COc1ccc(OC)c(Cc2nc3c(N)nc(C)nc3n2CCCC#N)c1 |
| InChI | InChI=1S/C19H22N6O2/c1-12-22-18(21)17-19(23-12)25(9-5-4-8-20)16(24-17)11-13-10-14(26-2)6-7-15(13)27-3/h6-7,10H,4-5,9,11H2,1-3H3,(H2,21,22,23) |
| InChIKey | CTJIPGJQHUSFDW-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 111.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 366.43 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 4-[6-amino-8-[(2,5-dimethoxyphenyl)methyl]-2-methylpurin-9-yl]butanenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[6-amino-8-[(2,5-dimethoxyphenyl)methyl]-2-methylpurin-9-yl]butanenitrile?
The IUPAC name of 4-[6-amino-8-[(2,5-dimethoxyphenyl)methyl]-2-methylpurin-9-yl]butanenitrile (CID 46907556) is 4-[6-amino-8-[(2,5-dimethoxyphenyl)methyl]-2-methylpurin-9-yl]butanenitrile.
What is the SMILES notation for 4-[6-amino-8-[(2,5-dimethoxyphenyl)methyl]-2-methylpurin-9-yl]butanenitrile?
The canonical SMILES for 4-[6-amino-8-[(2,5-dimethoxyphenyl)methyl]-2-methylpurin-9-yl]butanenitrile is COc1ccc(OC)c(Cc2nc3c(N)nc(C)nc3n2CCCC#N)c1.
What is the InChIKey of 4-[6-amino-8-[(2,5-dimethoxyphenyl)methyl]-2-methylpurin-9-yl]butanenitrile?
The InChIKey is CTJIPGJQHUSFDW-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H22N6O2/c1-12-22-18(21)17-19(23-12)25(9-5-4-8-20)16(24-17)11-13-10-14(26-2)6-7-15(13)27-3/h6-7,10H,4-5,9,11H2,1-3H3,(H2,21,22,23).
What are the key properties of 4-[6-amino-8-[(2,5-dimethoxyphenyl)methyl]-2-methylpurin-9-yl]butanenitrile?
4-[6-amino-8-[(2,5-dimethoxyphenyl)methyl]-2-methylpurin-9-yl]butanenitrile has a molecular weight of 366.43 g/mol, XLogP of 2.63, 7 rotatable bonds, 1 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[6-amino-8-[(2,5-dimethoxyphenyl)methyl]-2-methylpurin-9-yl]butanenitrile is sourced from PubChem (CID 46907556), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).