About [9-(4-fluorophenyl)pyrido[3,4-b]indol-3-yl]methanol;hydrobromide
[9-(4-fluorophenyl)pyrido[3,4-b]indol-3-yl]methanol;hydrobromide (PubChem CID 46907565) has the molecular formula C18H14BrFN2O
and a molecular weight of 373.23 g/mol. Its IUPAC name is [9-(4-fluorophenyl)pyrido[3,4-b]indol-3-yl]methanol;hydrobromide.
Molecular Properties
| Compound Name | [9-(4-fluorophenyl)pyrido[3,4-b]indol-3-yl]methanol;hydrobromide |
| PubChem CID | 46907565 |
| Molecular Formula | C18H14BrFN2O |
| Molecular Weight | 373.23 g/mol |
| Exact Mass | 372.03 |
| IUPAC Name | [9-(4-fluorophenyl)pyrido[3,4-b]indol-3-yl]methanol;hydrobromide |
| SMILES | Br.OCc1cc2c3ccccc3n(-c3ccc(F)cc3)c2cn1 |
| InChI | InChI=1S/C18H13FN2O.BrH/c19-12-5-7-14(8-6-12)21-17-4-2-1-3-15(17)16-9-13(11-22)20-10-18(16)21;/h1-10,22H,11H2;1H |
| InChIKey | DUBQVOQVRPEFRN-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 373.23 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [9-(4-fluorophenyl)pyrido[3,4-b]indol-3-yl]methanol;hydrobromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [9-(4-fluorophenyl)pyrido[3,4-b]indol-3-yl]methanol;hydrobromide?
The IUPAC name of [9-(4-fluorophenyl)pyrido[3,4-b]indol-3-yl]methanol;hydrobromide (CID 46907565) is [9-(4-fluorophenyl)pyrido[3,4-b]indol-3-yl]methanol;hydrobromide.
What is the SMILES notation for [9-(4-fluorophenyl)pyrido[3,4-b]indol-3-yl]methanol;hydrobromide?
The canonical SMILES for [9-(4-fluorophenyl)pyrido[3,4-b]indol-3-yl]methanol;hydrobromide is Br.OCc1cc2c3ccccc3n(-c3ccc(F)cc3)c2cn1.
What is the InChIKey of [9-(4-fluorophenyl)pyrido[3,4-b]indol-3-yl]methanol;hydrobromide?
The InChIKey is DUBQVOQVRPEFRN-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H13FN2O.BrH/c19-12-5-7-14(8-6-12)21-17-4-2-1-3-15(17)16-9-13(11-22)20-10-18(16)21;/h1-10,22H,11H2;1H.
What are the key properties of [9-(4-fluorophenyl)pyrido[3,4-b]indol-3-yl]methanol;hydrobromide?
[9-(4-fluorophenyl)pyrido[3,4-b]indol-3-yl]methanol;hydrobromide has a molecular weight of 373.23 g/mol, XLogP of 4.39, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [9-(4-fluorophenyl)pyrido[3,4-b]indol-3-yl]methanol;hydrobromide is sourced from PubChem (CID 46907565), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).