About 1-[5-(4-methylphenyl)-1,3,4-thiadiazol-2-yl]piperidine-4-carboxamide
1-[5-(4-methylphenyl)-1,3,4-thiadiazol-2-yl]piperidine-4-carboxamide (PubChem CID 46907692) has the molecular formula C15H18N4OS
and a molecular weight of 302.40 g/mol. Its IUPAC name is 1-[5-(4-methylphenyl)-1,3,4-thiadiazol-2-yl]piperidine-4-carboxamide.
Molecular Properties
| Compound Name | 1-[5-(4-methylphenyl)-1,3,4-thiadiazol-2-yl]piperidine-4-carboxamide |
| PubChem CID | 46907692 |
| Molecular Formula | C15H18N4OS |
| Molecular Weight | 302.40 g/mol |
| Exact Mass | 302.12 |
| IUPAC Name | 1-[5-(4-methylphenyl)-1,3,4-thiadiazol-2-yl]piperidine-4-carboxamide |
| SMILES | Cc1ccc(-c2nnc(N3CCC(C(N)=O)CC3)s2)cc1 |
| InChI | InChI=1S/C15H18N4OS/c1-10-2-4-12(5-3-10)14-17-18-15(21-14)19-8-6-11(7-9-19)13(16)20/h2-5,11H,6-9H2,1H3,(H2,16,20) |
| InChIKey | NFGBSXLARAJBBS-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 72.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 302.40 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-[5-(4-methylphenyl)-1,3,4-thiadiazol-2-yl]piperidine-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[5-(4-methylphenyl)-1,3,4-thiadiazol-2-yl]piperidine-4-carboxamide?
The IUPAC name of 1-[5-(4-methylphenyl)-1,3,4-thiadiazol-2-yl]piperidine-4-carboxamide (CID 46907692) is 1-[5-(4-methylphenyl)-1,3,4-thiadiazol-2-yl]piperidine-4-carboxamide.
What is the SMILES notation for 1-[5-(4-methylphenyl)-1,3,4-thiadiazol-2-yl]piperidine-4-carboxamide?
The canonical SMILES for 1-[5-(4-methylphenyl)-1,3,4-thiadiazol-2-yl]piperidine-4-carboxamide is Cc1ccc(-c2nnc(N3CCC(C(N)=O)CC3)s2)cc1.
What is the InChIKey of 1-[5-(4-methylphenyl)-1,3,4-thiadiazol-2-yl]piperidine-4-carboxamide?
The InChIKey is NFGBSXLARAJBBS-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H18N4OS/c1-10-2-4-12(5-3-10)14-17-18-15(21-14)19-8-6-11(7-9-19)13(16)20/h2-5,11H,6-9H2,1H3,(H2,16,20).
What are the key properties of 1-[5-(4-methylphenyl)-1,3,4-thiadiazol-2-yl]piperidine-4-carboxamide?
1-[5-(4-methylphenyl)-1,3,4-thiadiazol-2-yl]piperidine-4-carboxamide has a molecular weight of 302.40 g/mol, XLogP of 2.22, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[5-(4-methylphenyl)-1,3,4-thiadiazol-2-yl]piperidine-4-carboxamide is sourced from PubChem (CID 46907692), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).