About [1-[4-(4-bromophenyl)-1,3-thiazol-2-yl]piperidin-4-yl]-morpholin-4-ylmethanone
[1-[4-(4-bromophenyl)-1,3-thiazol-2-yl]piperidin-4-yl]-morpholin-4-ylmethanone (PubChem CID 46907697) has the molecular formula C19H22BrN3O2S
and a molecular weight of 436.38 g/mol. Its IUPAC name is [1-[4-(4-bromophenyl)-1,3-thiazol-2-yl]piperidin-4-yl]-morpholin-4-ylmethanone.
Molecular Properties
| Compound Name | [1-[4-(4-bromophenyl)-1,3-thiazol-2-yl]piperidin-4-yl]-morpholin-4-ylmethanone |
| PubChem CID | 46907697 |
| Molecular Formula | C19H22BrN3O2S |
| Molecular Weight | 436.38 g/mol |
| Exact Mass | 435.06 |
| IUPAC Name | [1-[4-(4-bromophenyl)-1,3-thiazol-2-yl]piperidin-4-yl]-morpholin-4-ylmethanone |
| SMILES | O=C(C1CCN(c2nc(-c3ccc(Br)cc3)cs2)CC1)N1CCOCC1 |
| InChI | InChI=1S/C19H22BrN3O2S/c20-16-3-1-14(2-4-16)17-13-26-19(21-17)23-7-5-15(6-8-23)18(24)22-9-11-25-12-10-22/h1-4,13,15H,5-12H2 |
| InChIKey | KTORMKKPKFYHGB-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 45.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 436.38 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [1-[4-(4-bromophenyl)-1,3-thiazol-2-yl]piperidin-4-yl]-morpholin-4-ylmethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-[4-(4-bromophenyl)-1,3-thiazol-2-yl]piperidin-4-yl]-morpholin-4-ylmethanone?
The IUPAC name of [1-[4-(4-bromophenyl)-1,3-thiazol-2-yl]piperidin-4-yl]-morpholin-4-ylmethanone (CID 46907697) is [1-[4-(4-bromophenyl)-1,3-thiazol-2-yl]piperidin-4-yl]-morpholin-4-ylmethanone.
What is the SMILES notation for [1-[4-(4-bromophenyl)-1,3-thiazol-2-yl]piperidin-4-yl]-morpholin-4-ylmethanone?
The canonical SMILES for [1-[4-(4-bromophenyl)-1,3-thiazol-2-yl]piperidin-4-yl]-morpholin-4-ylmethanone is O=C(C1CCN(c2nc(-c3ccc(Br)cc3)cs2)CC1)N1CCOCC1.
What is the InChIKey of [1-[4-(4-bromophenyl)-1,3-thiazol-2-yl]piperidin-4-yl]-morpholin-4-ylmethanone?
The InChIKey is KTORMKKPKFYHGB-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H22BrN3O2S/c20-16-3-1-14(2-4-16)17-13-26-19(21-17)23-7-5-15(6-8-23)18(24)22-9-11-25-12-10-22/h1-4,13,15H,5-12H2.
What are the key properties of [1-[4-(4-bromophenyl)-1,3-thiazol-2-yl]piperidin-4-yl]-morpholin-4-ylmethanone?
[1-[4-(4-bromophenyl)-1,3-thiazol-2-yl]piperidin-4-yl]-morpholin-4-ylmethanone has a molecular weight of 436.38 g/mol, XLogP of 3.65, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [1-[4-(4-bromophenyl)-1,3-thiazol-2-yl]piperidin-4-yl]-morpholin-4-ylmethanone is sourced from PubChem (CID 46907697), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).