About 1-[5-(4-chlorophenyl)-1,3-thiazol-2-yl]piperidine-4-carboxamide
1-[5-(4-chlorophenyl)-1,3-thiazol-2-yl]piperidine-4-carboxamide (PubChem CID 46907728) has the molecular formula C15H16ClN3OS
and a molecular weight of 321.83 g/mol. Its IUPAC name is 1-[5-(4-chlorophenyl)-1,3-thiazol-2-yl]piperidine-4-carboxamide.
Molecular Properties
| Compound Name | 1-[5-(4-chlorophenyl)-1,3-thiazol-2-yl]piperidine-4-carboxamide |
| PubChem CID | 46907728 |
| Molecular Formula | C15H16ClN3OS |
| Molecular Weight | 321.83 g/mol |
| Exact Mass | 321.07 |
| IUPAC Name | 1-[5-(4-chlorophenyl)-1,3-thiazol-2-yl]piperidine-4-carboxamide |
| SMILES | NC(=O)C1CCN(c2ncc(-c3ccc(Cl)cc3)s2)CC1 |
| InChI | InChI=1S/C15H16ClN3OS/c16-12-3-1-10(2-4-12)13-9-18-15(21-13)19-7-5-11(6-8-19)14(17)20/h1-4,9,11H,5-8H2,(H2,17,20) |
| InChIKey | QAZRFNUVFWZHRN-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 59.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 321.83 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-[5-(4-chlorophenyl)-1,3-thiazol-2-yl]piperidine-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[5-(4-chlorophenyl)-1,3-thiazol-2-yl]piperidine-4-carboxamide?
The IUPAC name of 1-[5-(4-chlorophenyl)-1,3-thiazol-2-yl]piperidine-4-carboxamide (CID 46907728) is 1-[5-(4-chlorophenyl)-1,3-thiazol-2-yl]piperidine-4-carboxamide.
What is the SMILES notation for 1-[5-(4-chlorophenyl)-1,3-thiazol-2-yl]piperidine-4-carboxamide?
The canonical SMILES for 1-[5-(4-chlorophenyl)-1,3-thiazol-2-yl]piperidine-4-carboxamide is NC(=O)C1CCN(c2ncc(-c3ccc(Cl)cc3)s2)CC1.
What is the InChIKey of 1-[5-(4-chlorophenyl)-1,3-thiazol-2-yl]piperidine-4-carboxamide?
The InChIKey is QAZRFNUVFWZHRN-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H16ClN3OS/c16-12-3-1-10(2-4-12)13-9-18-15(21-13)19-7-5-11(6-8-19)14(17)20/h1-4,9,11H,5-8H2,(H2,17,20).
What are the key properties of 1-[5-(4-chlorophenyl)-1,3-thiazol-2-yl]piperidine-4-carboxamide?
1-[5-(4-chlorophenyl)-1,3-thiazol-2-yl]piperidine-4-carboxamide has a molecular weight of 321.83 g/mol, XLogP of 3.17, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[5-(4-chlorophenyl)-1,3-thiazol-2-yl]piperidine-4-carboxamide is sourced from PubChem (CID 46907728), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).