C23H23FN2O2S — CID 46908251
2-[3-(4-fluorophenyl)propylsulfanyl]-N-[(2-methoxyphenyl)methyl]pyridine-3-carboxamide (PubChem CID 46908251) has the molecular formula C23H23FN2O2S and a molecular weight of 410.51 g/mol. Its IUPAC name is 2-[3-(4-fluorophenyl)propylsulfanyl]-N-[(2-methoxyphenyl)methyl]pyridine-3-carboxamide.
| Compound Name | 2-[3-(4-fluorophenyl)propylsulfanyl]-N-[(2-methoxyphenyl)methyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 46908251 |
| Molecular Formula | C23H23FN2O2S |
| Molecular Weight | 410.51 g/mol |
| Exact Mass | 410.15 |
| IUPAC Name | 2-[3-(4-fluorophenyl)propylsulfanyl]-N-[(2-methoxyphenyl)methyl]pyridine-3-carboxamide |
| SMILES | COc1ccccc1CNC(=O)c1cccnc1SCCCc1ccc(F)cc1 |
| InChI | InChI=1S/C23H23FN2O2S/c1-28-21-9-3-2-7-18(21)16-26-22(27)20-8-4-14-25-23(20)29-15-5-6-17-10-12-19(24)13-11-17/h2-4,7-14H,5-6,15-16H2,1H3,(H,26,27) |
| InChIKey | AHJUBDVQZBOQTB-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.51 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|