C22H21FN2O2S — CID 46908353
2-[3-(4-fluorophenyl)propylsulfanyl]-N-[(2-hydroxyphenyl)methyl]pyridine-3-carboxamide (PubChem CID 46908353) has the molecular formula C22H21FN2O2S and a molecular weight of 396.49 g/mol. Its IUPAC name is 2-[3-(4-fluorophenyl)propylsulfanyl]-N-[(2-hydroxyphenyl)methyl]pyridine-3-carboxamide.
| Compound Name | 2-[3-(4-fluorophenyl)propylsulfanyl]-N-[(2-hydroxyphenyl)methyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 46908353 |
| Molecular Formula | C22H21FN2O2S |
| Molecular Weight | 396.49 g/mol |
| Exact Mass | 396.13 |
| IUPAC Name | 2-[3-(4-fluorophenyl)propylsulfanyl]-N-[(2-hydroxyphenyl)methyl]pyridine-3-carboxamide |
| SMILES | O=C(NCc1ccccc1O)c1cccnc1SCCCc1ccc(F)cc1 |
| InChI | InChI=1S/C22H21FN2O2S/c23-18-11-9-16(10-12-18)5-4-14-28-22-19(7-3-13-24-22)21(27)25-15-17-6-1-2-8-20(17)26/h1-3,6-13,26H,4-5,14-15H2,(H,25,27) |
| InChIKey | NYMUEDQMFZKEJG-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.49 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|