C17H14BrN3O3 — CID 4690885
2-[[5-(2-bromophenyl)-1,3,4-oxadiazol-2-yl]methyl]-3a,4,7,7a-tetrahydroisoindole-1,3-dione (PubChem CID 4690885) has the molecular formula C17H14BrN3O3 and a molecular weight of 388.22 g/mol. Its IUPAC name is 2-[[5-(2-bromophenyl)-1,3,4-oxadiazol-2-yl]methyl]-3a,4,7,7a-tetrahydroisoindole-1,3-dione.
| Compound Name | 2-[[5-(2-bromophenyl)-1,3,4-oxadiazol-2-yl]methyl]-3a,4,7,7a-tetrahydroisoindole-1,3-dione |
|---|---|
| PubChem CID | 4690885 |
| Molecular Formula | C17H14BrN3O3 |
| Molecular Weight | 388.22 g/mol |
| Exact Mass | 387.02 |
| IUPAC Name | 2-[[5-(2-bromophenyl)-1,3,4-oxadiazol-2-yl]methyl]-3a,4,7,7a-tetrahydroisoindole-1,3-dione |
| SMILES | O=C1C2CC=CCC2C(=O)N1Cc1nnc(-c2ccccc2Br)o1 |
| InChI | InChI=1S/C17H14BrN3O3/c18-13-8-4-3-7-12(13)15-20-19-14(24-15)9-21-16(22)10-5-1-2-6-11(10)17(21)23/h1-4,7-8,10-11H,5-6,9H2 |
| InChIKey | ZQZPQPHNXNZVLL-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 76.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.22 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|