C22H24N8O2S — CID 46908868
N-[3-[2-[(6-morpholin-4-yl-3-pyridinyl)amino]pyrrolo[2,3-d]pyrimidin-7-yl]propyl]-1,3-thiazole-5-carboxamide (PubChem CID 46908868) has the molecular formula C22H24N8O2S and a molecular weight of 464.56 g/mol. Its IUPAC name is N-[3-[2-[(6-morpholin-4-yl-3-pyridinyl)amino]pyrrolo[2,3-d]pyrimidin-7-yl]propyl]-1,3-thiazole-5-carboxamide.
| Compound Name | N-[3-[2-[(6-morpholin-4-yl-3-pyridinyl)amino]pyrrolo[2,3-d]pyrimidin-7-yl]propyl]-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 46908868 |
| Molecular Formula | C22H24N8O2S |
| Molecular Weight | 464.56 g/mol |
| Exact Mass | 464.17 |
| IUPAC Name | N-[3-[2-[(6-morpholin-4-yl-3-pyridinyl)amino]pyrrolo[2,3-d]pyrimidin-7-yl]propyl]-1,3-thiazole-5-carboxamide |
| SMILES | O=C(NCCCn1ccc2cnc(Nc3ccc(N4CCOCC4)nc3)nc21)c1cncs1 |
| InChI | InChI=1S/C22H24N8O2S/c31-21(18-14-23-15-33-18)24-5-1-6-30-7-4-16-12-26-22(28-20(16)30)27-17-2-3-19(25-13-17)29-8-10-32-11-9-29/h2-4,7,12-15H,1,5-6,8-11H2,(H,24,31)(H,26,27,28) |
| InChIKey | SVMVLQNRBXGIIV-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 110.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.56 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|