C22H18ClN3O2 — CID 46909302
3-(6-chloro-3-pyridinyl)-5-[3-(methoxymethyl)-4-(2-methylphenyl)phenyl]-1,2,4-oxadiazole (PubChem CID 46909302) has the molecular formula C22H18ClN3O2 and a molecular weight of 391.86 g/mol. Its IUPAC name is 3-(6-chloro-3-pyridinyl)-5-[3-(methoxymethyl)-4-(2-methylphenyl)phenyl]-1,2,4-oxadiazole.
| Compound Name | 3-(6-chloro-3-pyridinyl)-5-[3-(methoxymethyl)-4-(2-methylphenyl)phenyl]-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 46909302 |
| Molecular Formula | C22H18ClN3O2 |
| Molecular Weight | 391.86 g/mol |
| Exact Mass | 391.11 |
| IUPAC Name | 3-(6-chloro-3-pyridinyl)-5-[3-(methoxymethyl)-4-(2-methylphenyl)phenyl]-1,2,4-oxadiazole |
| SMILES | COCc1cc(-c2nc(-c3ccc(Cl)nc3)no2)ccc1-c1ccccc1C |
| InChI | InChI=1S/C22H18ClN3O2/c1-14-5-3-4-6-18(14)19-9-7-15(11-17(19)13-27-2)22-25-21(26-28-22)16-8-10-20(23)24-12-16/h3-12H,13H2,1-2H3 |
| InChIKey | KDIFZOOMYSBBTE-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 61.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.86 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|