C18H17FN4O2 — CID 46909509
1-(6-fluoro-2-pyridinyl)-3-(6-oxo-2,3,4,10b-tetrahydro-1H-pyrido[2,1-a]isoindol-10-yl)urea (PubChem CID 46909509) has the molecular formula C18H17FN4O2 and a molecular weight of 340.36 g/mol. Its IUPAC name is 1-(6-fluoro-2-pyridinyl)-3-(6-oxo-2,3,4,10b-tetrahydro-1H-pyrido[2,1-a]isoindol-10-yl)urea.
| Compound Name | 1-(6-fluoro-2-pyridinyl)-3-(6-oxo-2,3,4,10b-tetrahydro-1H-pyrido[2,1-a]isoindol-10-yl)urea |
|---|---|
| PubChem CID | 46909509 |
| Molecular Formula | C18H17FN4O2 |
| Molecular Weight | 340.36 g/mol |
| Exact Mass | 340.13 |
| IUPAC Name | 1-(6-fluoro-2-pyridinyl)-3-(6-oxo-2,3,4,10b-tetrahydro-1H-pyrido[2,1-a]isoindol-10-yl)urea |
| SMILES | O=C(Nc1cccc(F)n1)Nc1cccc2c1C1CCCCN1C2=O |
| InChI | InChI=1S/C18H17FN4O2/c19-14-8-4-9-15(21-14)22-18(25)20-12-6-3-5-11-16(12)13-7-1-2-10-23(13)17(11)24/h3-6,8-9,13H,1-2,7,10H2,(H2,20,21,22,25) |
| InChIKey | PRRNEKPNFWMEPT-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 74.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.36 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|