C19H19N5O2S2 — CID 46909511
1-(6-oxospiro[1,3,4,10b-tetrahydropyrido[2,1-a]isoindole-2,2'-1,3-dithiolane]-10-yl)-3-pyrazin-2-ylurea (PubChem CID 46909511) has the molecular formula C19H19N5O2S2 and a molecular weight of 413.53 g/mol. Its IUPAC name is 1-(6-oxospiro[1,3,4,10b-tetrahydropyrido[2,1-a]isoindole-2,2'-1,3-dithiolane]-10-yl)-3-pyrazin-2-ylurea.
| Compound Name | 1-(6-oxospiro[1,3,4,10b-tetrahydropyrido[2,1-a]isoindole-2,2'-1,3-dithiolane]-10-yl)-3-pyrazin-2-ylurea |
|---|---|
| PubChem CID | 46909511 |
| Molecular Formula | C19H19N5O2S2 |
| Molecular Weight | 413.53 g/mol |
| Exact Mass | 413.10 |
| IUPAC Name | 1-(6-oxospiro[1,3,4,10b-tetrahydropyrido[2,1-a]isoindole-2,2'-1,3-dithiolane]-10-yl)-3-pyrazin-2-ylurea |
| SMILES | O=C(Nc1cnccn1)Nc1cccc2c1C1CC3(CCN1C2=O)SCCS3 |
| InChI | InChI=1S/C19H19N5O2S2/c25-17-12-2-1-3-13(22-18(26)23-15-11-20-5-6-21-15)16(12)14-10-19(4-7-24(14)17)27-8-9-28-19/h1-3,5-6,11,14H,4,7-10H2,(H2,21,22,23,26) |
| InChIKey | AKKQLMPWVUMKJQ-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 87.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.53 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |