C13H25BO3 — CID 46909761
(4S)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)heptan-2-one (PubChem CID 46909761) has the molecular formula C13H25BO3 and a molecular weight of 240.15 g/mol. Its IUPAC name is (4S)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)heptan-2-one.
| Compound Name | (4S)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)heptan-2-one |
|---|---|
| PubChem CID | 46909761 |
| Molecular Formula | C13H25BO3 |
| Molecular Weight | 240.15 g/mol |
| Exact Mass | 240.19 |
| IUPAC Name | (4S)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)heptan-2-one |
| SMILES | CCC[C@@H](CC(C)=O)B1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C13H25BO3/c1-7-8-11(9-10(2)15)14-16-12(3,4)13(5,6)17-14/h11H,7-9H2,1-6H3/t11-/m0/s1 |
| InChIKey | ADRMGEAELTVPSU-NSHDSACASA-N |
| XLogP | 3.23 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.15 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|