C20H28O3 — CID 46909964
(3R,4aS,6aR,10aS,10bR)-3-ethenyl-3,4a,7,7,10a-pentamethyl-2,6,6a,10b-tetrahydro-1H-benzo[f]chromene-5,8-dione (PubChem CID 46909964) has the molecular formula C20H28O3 and a molecular weight of 316.44 g/mol. Its IUPAC name is (3R,4aS,6aR,10aS,10bR)-3-ethenyl-3,4a,7,7,10a-pentamethyl-2,6,6a,10b-tetrahydro-1H-benzo[f]chromene-5,8-dione.
| Compound Name | (3R,4aS,6aR,10aS,10bR)-3-ethenyl-3,4a,7,7,10a-pentamethyl-2,6,6a,10b-tetrahydro-1H-benzo[f]chromene-5,8-dione |
|---|---|
| PubChem CID | 46909964 |
| Molecular Formula | C20H28O3 |
| Molecular Weight | 316.44 g/mol |
| Exact Mass | 316.20 |
| IUPAC Name | (3R,4aS,6aR,10aS,10bR)-3-ethenyl-3,4a,7,7,10a-pentamethyl-2,6,6a,10b-tetrahydro-1H-benzo[f]chromene-5,8-dione |
| SMILES | C=C[C@@]1(C)CC[C@@H]2[C@@]3(C)C=CC(=O)C(C)(C)[C@@H]3CC(=O)[C@@]2(C)O1 |
| InChI | InChI=1S/C20H28O3/c1-7-18(4)10-8-13-19(5)11-9-15(21)17(2,3)14(19)12-16(22)20(13,6)23-18/h7,9,11,13-14H,1,8,10,12H2,2-6H3/t13-,14+,18+,19-,20+/m1/s1 |
| InChIKey | DUQFXNSONKEZQH-QPDGGIQXSA-N |
| XLogP | 3.88 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.44 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|