C25H22F3N5O2 — CID 46910143
1-(4,4-difluorocyclohexyl)-7-(5-fluoro-2,3-dihydroindole-1-carbonyl)-8-methyl-5H-[1,2,4]triazolo[4,3-a]quinoxalin-4-one (PubChem CID 46910143) has the molecular formula C25H22F3N5O2 and a molecular weight of 481.48 g/mol. Its IUPAC name is 1-(4,4-difluorocyclohexyl)-7-(5-fluoro-2,3-dihydroindole-1-carbonyl)-8-methyl-5H-[1,2,4]triazolo[4,3-a]quinoxalin-4-one.
| Compound Name | 1-(4,4-difluorocyclohexyl)-7-(5-fluoro-2,3-dihydroindole-1-carbonyl)-8-methyl-5H-[1,2,4]triazolo[4,3-a]quinoxalin-4-one |
|---|---|
| PubChem CID | 46910143 |
| Molecular Formula | C25H22F3N5O2 |
| Molecular Weight | 481.48 g/mol |
| Exact Mass | 481.17 |
| IUPAC Name | 1-(4,4-difluorocyclohexyl)-7-(5-fluoro-2,3-dihydroindole-1-carbonyl)-8-methyl-5H-[1,2,4]triazolo[4,3-a]quinoxalin-4-one |
| SMILES | Cc1cc2c(cc1C(=O)N1CCc3cc(F)ccc31)[nH]c(=O)c1nnc(C3CCC(F)(F)CC3)n12 |
| InChI | InChI=1S/C25H22F3N5O2/c1-13-10-20-18(12-17(13)24(35)32-9-6-15-11-16(26)2-3-19(15)32)29-23(34)22-31-30-21(33(20)22)14-4-7-25(27,28)8-5-14/h2-3,10-12,14H,4-9H2,1H3,(H,29,34) |
| InChIKey | HZFWSJKSGUKXJL-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 83.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.48 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |