C16H12Cl5F3N4OS — CID 46910269
1-[2,6-dichloro-4-(trifluoromethyl)phenyl]-4-ethylsulfanyl-5-[(2,2,2-trichloro-1-methoxyethyl)amino]pyrazole-3-carbonitrile (PubChem CID 46910269) has the molecular formula C16H12Cl5F3N4OS and a molecular weight of 542.63 g/mol. Its IUPAC name is 1-[2,6-dichloro-4-(trifluoromethyl)phenyl]-4-ethylsulfanyl-5-[(2,2,2-trichloro-1-methoxyethyl)amino]pyrazole-3-carbonitrile.
| Compound Name | 1-[2,6-dichloro-4-(trifluoromethyl)phenyl]-4-ethylsulfanyl-5-[(2,2,2-trichloro-1-methoxyethyl)amino]pyrazole-3-carbonitrile |
|---|---|
| PubChem CID | 46910269 |
| Molecular Formula | C16H12Cl5F3N4OS |
| Molecular Weight | 542.63 g/mol |
| Exact Mass | 539.91 |
| IUPAC Name | 1-[2,6-dichloro-4-(trifluoromethyl)phenyl]-4-ethylsulfanyl-5-[(2,2,2-trichloro-1-methoxyethyl)amino]pyrazole-3-carbonitrile |
| SMILES | CCSc1c(C#N)nn(-c2c(Cl)cc(C(F)(F)F)cc2Cl)c1NC(OC)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C16H12Cl5F3N4OS/c1-3-30-12-10(6-25)27-28(13(12)26-14(29-2)15(19,20)21)11-8(17)4-7(5-9(11)18)16(22,23)24/h4-5,14,26H,3H2,1-2H3 |
| InChIKey | IQHZDDWNKYHVMU-UHFFFAOYSA-N |
| XLogP | 6.94 |
| TPSA | 62.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.63 |
| LogP ≤ 5 | 6.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|