C18H28N2O2 — CID 46910690
ethyl (E)-3-(diethylamino)-3-(1-methyl-4,5,6,7-tetrahydroindol-2-yl)prop-2-enoate (PubChem CID 46910690) has the molecular formula C18H28N2O2 and a molecular weight of 304.43 g/mol. Its IUPAC name is ethyl (E)-3-(diethylamino)-3-(1-methyl-4,5,6,7-tetrahydroindol-2-yl)prop-2-enoate.
| Compound Name | ethyl (E)-3-(diethylamino)-3-(1-methyl-4,5,6,7-tetrahydroindol-2-yl)prop-2-enoate |
|---|---|
| PubChem CID | 46910690 |
| Molecular Formula | C18H28N2O2 |
| Molecular Weight | 304.43 g/mol |
| Exact Mass | 304.22 |
| IUPAC Name | ethyl (E)-3-(diethylamino)-3-(1-methyl-4,5,6,7-tetrahydroindol-2-yl)prop-2-enoate |
| SMILES | CCOC(=O)/C=C(\c1cc2c(n1C)CCCC2)N(CC)CC |
| InChI | InChI=1S/C18H28N2O2/c1-5-20(6-2)17(13-18(21)22-7-3)16-12-14-10-8-9-11-15(14)19(16)4/h12-13H,5-11H2,1-4H3/b17-13+ |
| InChIKey | OBROTKWMTXIPLB-GHRIWEEISA-N |
| XLogP | 3.15 |
| TPSA | 34.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.43 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|