C23H28N6O2S — CID 46910850
(2R,3R)-2-[[8-propan-2-yl-4-[(4-thiophen-3-ylphenyl)methylamino]pyrazolo[1,5-a][1,3,5]triazin-2-yl]amino]butane-1,3-diol (PubChem CID 46910850) has the molecular formula C23H28N6O2S and a molecular weight of 452.58 g/mol. Its IUPAC name is (2R,3R)-2-[[8-propan-2-yl-4-[(4-thiophen-3-ylphenyl)methylamino]pyrazolo[1,5-a][1,3,5]triazin-2-yl]amino]butane-1,3-diol.
| Compound Name | (2R,3R)-2-[[8-propan-2-yl-4-[(4-thiophen-3-ylphenyl)methylamino]pyrazolo[1,5-a][1,3,5]triazin-2-yl]amino]butane-1,3-diol |
|---|---|
| PubChem CID | 46910850 |
| Molecular Formula | C23H28N6O2S |
| Molecular Weight | 452.58 g/mol |
| Exact Mass | 452.20 |
| IUPAC Name | (2R,3R)-2-[[8-propan-2-yl-4-[(4-thiophen-3-ylphenyl)methylamino]pyrazolo[1,5-a][1,3,5]triazin-2-yl]amino]butane-1,3-diol |
| SMILES | CC(C)c1cnn2c(NCc3ccc(-c4ccsc4)cc3)nc(N[C@H](CO)[C@@H](C)O)nc12 |
| InChI | InChI=1S/C23H28N6O2S/c1-14(2)19-11-25-29-21(19)27-22(26-20(12-30)15(3)31)28-23(29)24-10-16-4-6-17(7-5-16)18-8-9-32-13-18/h4-9,11,13-15,20,30-31H,10,12H2,1-3H3,(H2,24,26,27,28)/t15-,20-/m1/s1 |
| InChIKey | LWQGYJWOXXBKID-FOIQADDNSA-N |
| XLogP | 3.74 |
| TPSA | 107.60 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.58 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |