About 1-[3-(tert-butyliminomethyl)spiro[1,3-benzothiazole-2,4'-piperidine]-1'-yl]ethanone
1-[3-(tert-butyliminomethyl)spiro[1,3-benzothiazole-2,4'-piperidine]-1'-yl]ethanone (PubChem CID 46910960) has the molecular formula C18H25N3OS
and a molecular weight of 331.49 g/mol. Its IUPAC name is 1-[3-(tert-butyliminomethyl)spiro[1,3-benzothiazole-2,4'-piperidine]-1'-yl]ethanone.
Molecular Properties
| Compound Name | 1-[3-(tert-butyliminomethyl)spiro[1,3-benzothiazole-2,4'-piperidine]-1'-yl]ethanone |
| PubChem CID | 46910960 |
| Molecular Formula | C18H25N3OS |
| Molecular Weight | 331.49 g/mol |
| Exact Mass | 331.17 |
| IUPAC Name | 1-[3-(tert-butyliminomethyl)spiro[1,3-benzothiazole-2,4'-piperidine]-1'-yl]ethanone |
| SMILES | CC(=O)N1CCC2(CC1)Sc1ccccc1N2/C=N/C(C)(C)C |
| InChI | InChI=1S/C18H25N3OS/c1-14(22)20-11-9-18(10-12-20)21(13-19-17(2,3)4)15-7-5-6-8-16(15)23-18/h5-8,13H,9-12H2,1-4H3/b19-13+ |
| InChIKey | UCMXRLZWNULUON-CPNJWEJPSA-N |
| XLogP | 3.76 |
| TPSA | 35.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 331.49 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 1-[3-(tert-butyliminomethyl)spiro[1,3-benzothiazole-2,4'-piperidine]-1'-yl]ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[3-(tert-butyliminomethyl)spiro[1,3-benzothiazole-2,4'-piperidine]-1'-yl]ethanone?
The IUPAC name of 1-[3-(tert-butyliminomethyl)spiro[1,3-benzothiazole-2,4'-piperidine]-1'-yl]ethanone (CID 46910960) is 1-[3-(tert-butyliminomethyl)spiro[1,3-benzothiazole-2,4'-piperidine]-1'-yl]ethanone.
What is the SMILES notation for 1-[3-(tert-butyliminomethyl)spiro[1,3-benzothiazole-2,4'-piperidine]-1'-yl]ethanone?
The canonical SMILES for 1-[3-(tert-butyliminomethyl)spiro[1,3-benzothiazole-2,4'-piperidine]-1'-yl]ethanone is CC(=O)N1CCC2(CC1)Sc1ccccc1N2/C=N/C(C)(C)C.
What is the InChIKey of 1-[3-(tert-butyliminomethyl)spiro[1,3-benzothiazole-2,4'-piperidine]-1'-yl]ethanone?
The InChIKey is UCMXRLZWNULUON-CPNJWEJPSA-N. The full InChI is InChI=1S/C18H25N3OS/c1-14(22)20-11-9-18(10-12-20)21(13-19-17(2,3)4)15-7-5-6-8-16(15)23-18/h5-8,13H,9-12H2,1-4H3/b19-13+.
What are the key properties of 1-[3-(tert-butyliminomethyl)spiro[1,3-benzothiazole-2,4'-piperidine]-1'-yl]ethanone?
1-[3-(tert-butyliminomethyl)spiro[1,3-benzothiazole-2,4'-piperidine]-1'-yl]ethanone has a molecular weight of 331.49 g/mol, XLogP of 3.76, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[3-(tert-butyliminomethyl)spiro[1,3-benzothiazole-2,4'-piperidine]-1'-yl]ethanone is sourced from PubChem (CID 46910960), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).