About (2,3-dibromo-4,5-dihydroxyphenyl)-phenylmethanone
(2,3-dibromo-4,5-dihydroxyphenyl)-phenylmethanone (PubChem CID 46911010) has the molecular formula C13H8Br2O3
and a molecular weight of 372.01 g/mol. Its IUPAC name is (2,3-dibromo-4,5-dihydroxyphenyl)-phenylmethanone.
Molecular Properties
| Compound Name | (2,3-dibromo-4,5-dihydroxyphenyl)-phenylmethanone |
| PubChem CID | 46911010 |
| Molecular Formula | C13H8Br2O3 |
| Molecular Weight | 372.01 g/mol |
| Exact Mass | 369.88 |
| IUPAC Name | (2,3-dibromo-4,5-dihydroxyphenyl)-phenylmethanone |
| SMILES | O=C(c1ccccc1)c1cc(O)c(O)c(Br)c1Br |
| InChI | InChI=1S/C13H8Br2O3/c14-10-8(6-9(16)13(18)11(10)15)12(17)7-4-2-1-3-5-7/h1-6,16,18H |
| InChIKey | XVDJQTFJBGDHEK-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 372.01 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|
Analyze (2,3-dibromo-4,5-dihydroxyphenyl)-phenylmethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2,3-dibromo-4,5-dihydroxyphenyl)-phenylmethanone?
The IUPAC name of (2,3-dibromo-4,5-dihydroxyphenyl)-phenylmethanone (CID 46911010) is (2,3-dibromo-4,5-dihydroxyphenyl)-phenylmethanone.
What is the SMILES notation for (2,3-dibromo-4,5-dihydroxyphenyl)-phenylmethanone?
The canonical SMILES for (2,3-dibromo-4,5-dihydroxyphenyl)-phenylmethanone is O=C(c1ccccc1)c1cc(O)c(O)c(Br)c1Br.
What is the InChIKey of (2,3-dibromo-4,5-dihydroxyphenyl)-phenylmethanone?
The InChIKey is XVDJQTFJBGDHEK-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H8Br2O3/c14-10-8(6-9(16)13(18)11(10)15)12(17)7-4-2-1-3-5-7/h1-6,16,18H.
What are the key properties of (2,3-dibromo-4,5-dihydroxyphenyl)-phenylmethanone?
(2,3-dibromo-4,5-dihydroxyphenyl)-phenylmethanone has a molecular weight of 372.01 g/mol, XLogP of 3.85, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2,3-dibromo-4,5-dihydroxyphenyl)-phenylmethanone is sourced from PubChem (CID 46911010), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).