C26H20F3NO6S — CID 46911143
[(1S)-2-[4-[(2,4-dioxo-1,3-thiazolidin-5-yl)methyl]phenoxy]-1-[4-(trifluoromethoxy)phenyl]ethyl] benzoate (PubChem CID 46911143) has the molecular formula C26H20F3NO6S and a molecular weight of 531.51 g/mol. Its IUPAC name is [(1S)-2-[4-[(2,4-dioxo-1,3-thiazolidin-5-yl)methyl]phenoxy]-1-[4-(trifluoromethoxy)phenyl]ethyl] benzoate.
| Compound Name | [(1S)-2-[4-[(2,4-dioxo-1,3-thiazolidin-5-yl)methyl]phenoxy]-1-[4-(trifluoromethoxy)phenyl]ethyl] benzoate |
|---|---|
| PubChem CID | 46911143 |
| Molecular Formula | C26H20F3NO6S |
| Molecular Weight | 531.51 g/mol |
| Exact Mass | 531.10 |
| IUPAC Name | [(1S)-2-[4-[(2,4-dioxo-1,3-thiazolidin-5-yl)methyl]phenoxy]-1-[4-(trifluoromethoxy)phenyl]ethyl] benzoate |
| SMILES | O=C1NC(=O)C(Cc2ccc(OC[C@@H](OC(=O)c3ccccc3)c3ccc(OC(F)(F)F)cc3)cc2)S1 |
| InChI | InChI=1S/C26H20F3NO6S/c27-26(28,29)36-20-12-8-17(9-13-20)21(35-24(32)18-4-2-1-3-5-18)15-34-19-10-6-16(7-11-19)14-22-23(31)30-25(33)37-22/h1-13,21-22H,14-15H2,(H,30,31,33)/t21-,22?/m1/s1 |
| InChIKey | YIVZAPUMGXOILX-ZMFCMNQTSA-N |
| XLogP | 5.46 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.51 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|