C28H33F3O4 — CID 46911162
4-[2-[(1S,2R,4aS,8aS)-1,4a,5-trimethyl-7-oxo-2-[[4-(trifluoromethyl)phenyl]methoxymethyl]-3,4,8,8a-tetrahydro-2H-naphthalen-1-yl]ethyl]-2H-furan-5-one (PubChem CID 46911162) has the molecular formula C28H33F3O4 and a molecular weight of 490.56 g/mol. Its IUPAC name is 4-[2-[(1S,2R,4aS,8aS)-1,4a,5-trimethyl-7-oxo-2-[[4-(trifluoromethyl)phenyl]methoxymethyl]-3,4,8,8a-tetrahydro-2H-naphthalen-1-yl]ethyl]-2H-furan-5-one.
| Compound Name | 4-[2-[(1S,2R,4aS,8aS)-1,4a,5-trimethyl-7-oxo-2-[[4-(trifluoromethyl)phenyl]methoxymethyl]-3,4,8,8a-tetrahydro-2H-naphthalen-1-yl]ethyl]-2H-furan-5-one |
|---|---|
| PubChem CID | 46911162 |
| Molecular Formula | C28H33F3O4 |
| Molecular Weight | 490.56 g/mol |
| Exact Mass | 490.23 |
| IUPAC Name | 4-[2-[(1S,2R,4aS,8aS)-1,4a,5-trimethyl-7-oxo-2-[[4-(trifluoromethyl)phenyl]methoxymethyl]-3,4,8,8a-tetrahydro-2H-naphthalen-1-yl]ethyl]-2H-furan-5-one |
| SMILES | CC1=CC(=O)C[C@H]2[C@](C)(CCC3=CCOC3=O)[C@H](COCc3ccc(C(F)(F)F)cc3)CC[C@]12C |
| InChI | InChI=1S/C28H33F3O4/c1-18-14-23(32)15-24-26(18,2)12-9-22(27(24,3)11-8-20-10-13-35-25(20)33)17-34-16-19-4-6-21(7-5-19)28(29,30)31/h4-7,10,14,22,24H,8-9,11-13,15-17H2,1-3H3/t22-,24+,26+,27+/m0/s1 |
| InChIKey | CJKFVLJZTZFMQL-BMJBQGFASA-N |
| XLogP | 6.44 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.56 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |