C27H33FO4 — CID 46911163
4-[2-[(1S,2R,4aS,8aS)-2-[(4-fluorophenyl)methoxymethyl]-1,4a,5-trimethyl-7-oxo-3,4,8,8a-tetrahydro-2H-naphthalen-1-yl]ethyl]-2H-furan-5-one (PubChem CID 46911163) has the molecular formula C27H33FO4 and a molecular weight of 440.56 g/mol. Its IUPAC name is 4-[2-[(1S,2R,4aS,8aS)-2-[(4-fluorophenyl)methoxymethyl]-1,4a,5-trimethyl-7-oxo-3,4,8,8a-tetrahydro-2H-naphthalen-1-yl]ethyl]-2H-furan-5-one.
| Compound Name | 4-[2-[(1S,2R,4aS,8aS)-2-[(4-fluorophenyl)methoxymethyl]-1,4a,5-trimethyl-7-oxo-3,4,8,8a-tetrahydro-2H-naphthalen-1-yl]ethyl]-2H-furan-5-one |
|---|---|
| PubChem CID | 46911163 |
| Molecular Formula | C27H33FO4 |
| Molecular Weight | 440.56 g/mol |
| Exact Mass | 440.24 |
| IUPAC Name | 4-[2-[(1S,2R,4aS,8aS)-2-[(4-fluorophenyl)methoxymethyl]-1,4a,5-trimethyl-7-oxo-3,4,8,8a-tetrahydro-2H-naphthalen-1-yl]ethyl]-2H-furan-5-one |
| SMILES | CC1=CC(=O)C[C@H]2[C@](C)(CCC3=CCOC3=O)[C@H](COCc3ccc(F)cc3)CC[C@]12C |
| InChI | InChI=1S/C27H33FO4/c1-18-14-23(29)15-24-26(18,2)12-9-21(17-31-16-19-4-6-22(28)7-5-19)27(24,3)11-8-20-10-13-32-25(20)30/h4-7,10,14,21,24H,8-9,11-13,15-17H2,1-3H3/t21-,24+,26+,27+/m0/s1 |
| InChIKey | NNIQBVZVYGUHBR-ZEJPXBKLSA-N |
| XLogP | 5.56 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.56 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |