C23H23NO2S — CID 46911331
3-[2-(4-methylcyclohexyl)-3-pyridinyl]-5-phenylthiophene-2-carboxylic acid (PubChem CID 46911331) has the molecular formula C23H23NO2S and a molecular weight of 377.51 g/mol. Its IUPAC name is 3-[2-(4-methylcyclohexyl)-3-pyridinyl]-5-phenylthiophene-2-carboxylic acid.
| Compound Name | 3-[2-(4-methylcyclohexyl)-3-pyridinyl]-5-phenylthiophene-2-carboxylic acid |
|---|---|
| PubChem CID | 46911331 |
| Molecular Formula | C23H23NO2S |
| Molecular Weight | 377.51 g/mol |
| Exact Mass | 377.14 |
| IUPAC Name | 3-[2-(4-methylcyclohexyl)-3-pyridinyl]-5-phenylthiophene-2-carboxylic acid |
| SMILES | CC1CCC(c2ncccc2-c2cc(-c3ccccc3)sc2C(=O)O)CC1 |
| InChI | InChI=1S/C23H23NO2S/c1-15-9-11-17(12-10-15)21-18(8-5-13-24-21)19-14-20(27-22(19)23(25)26)16-6-3-2-4-7-16/h2-8,13-15,17H,9-12H2,1H3,(H,25,26) |
| InChIKey | RQFZAYJQQYIOGT-UHFFFAOYSA-N |
| XLogP | 6.47 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.51 |
| LogP ≤ 5 | 6.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |