C24H28Cl2N2O2 — CID 46911379
N-(3,5-dichlorophenyl)-1-nonanoyl-2,3-dihydroindole-2-carboxamide (PubChem CID 46911379) has the molecular formula C24H28Cl2N2O2 and a molecular weight of 447.41 g/mol. Its IUPAC name is N-(3,5-dichlorophenyl)-1-nonanoyl-2,3-dihydroindole-2-carboxamide.
| Compound Name | N-(3,5-dichlorophenyl)-1-nonanoyl-2,3-dihydroindole-2-carboxamide |
|---|---|
| PubChem CID | 46911379 |
| Molecular Formula | C24H28Cl2N2O2 |
| Molecular Weight | 447.41 g/mol |
| Exact Mass | 446.15 |
| IUPAC Name | N-(3,5-dichlorophenyl)-1-nonanoyl-2,3-dihydroindole-2-carboxamide |
| SMILES | CCCCCCCCC(=O)N1c2ccccc2CC1C(=O)Nc1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C24H28Cl2N2O2/c1-2-3-4-5-6-7-12-23(29)28-21-11-9-8-10-17(21)13-22(28)24(30)27-20-15-18(25)14-19(26)16-20/h8-11,14-16,22H,2-7,12-13H2,1H3,(H,27,30) |
| InChIKey | UKIHTTOWLZLBIC-UHFFFAOYSA-N |
| XLogP | 6.64 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.41 |
| LogP ≤ 5 | 6.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|