About 2-[4-(3-oxo-1,2-benzoselenazol-2-yl)butyl]-1,2-benzoselenazol-3-one
2-[4-(3-oxo-1,2-benzoselenazol-2-yl)butyl]-1,2-benzoselenazol-3-one (PubChem CID 46911402) has the molecular formula C18H16N2O2Se2
and a molecular weight of 450.26 g/mol. Its IUPAC name is 2-[4-(3-oxo-1,2-benzoselenazol-2-yl)butyl]-1,2-benzoselenazol-3-one.
Molecular Properties
| Compound Name | 2-[4-(3-oxo-1,2-benzoselenazol-2-yl)butyl]-1,2-benzoselenazol-3-one |
| PubChem CID | 46911402 |
| Molecular Formula | C18H16N2O2Se2 |
| Molecular Weight | 450.26 g/mol |
| Exact Mass | 451.95 |
| IUPAC Name | 2-[4-(3-oxo-1,2-benzoselenazol-2-yl)butyl]-1,2-benzoselenazol-3-one |
| SMILES | O=c1c2ccccc2[se]n1CCCCn1[se]c2ccccc2c1=O |
| InChI | InChI=1S/C18H16N2O2Se2/c21-17-13-7-1-3-9-15(13)23-19(17)11-5-6-12-20-18(22)14-8-2-4-10-16(14)24-20/h1-4,7-10H,5-6,11-12H2 |
| InChIKey | CVIORDGEMWGHPD-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 44.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 450.26 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 2-[4-(3-oxo-1,2-benzoselenazol-2-yl)butyl]-1,2-benzoselenazol-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[4-(3-oxo-1,2-benzoselenazol-2-yl)butyl]-1,2-benzoselenazol-3-one?
The IUPAC name of 2-[4-(3-oxo-1,2-benzoselenazol-2-yl)butyl]-1,2-benzoselenazol-3-one (CID 46911402) is 2-[4-(3-oxo-1,2-benzoselenazol-2-yl)butyl]-1,2-benzoselenazol-3-one.
What is the SMILES notation for 2-[4-(3-oxo-1,2-benzoselenazol-2-yl)butyl]-1,2-benzoselenazol-3-one?
The canonical SMILES for 2-[4-(3-oxo-1,2-benzoselenazol-2-yl)butyl]-1,2-benzoselenazol-3-one is O=c1c2ccccc2[se]n1CCCCn1[se]c2ccccc2c1=O.
What is the InChIKey of 2-[4-(3-oxo-1,2-benzoselenazol-2-yl)butyl]-1,2-benzoselenazol-3-one?
The InChIKey is CVIORDGEMWGHPD-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H16N2O2Se2/c21-17-13-7-1-3-9-15(13)23-19(17)11-5-6-12-20-18(22)14-8-2-4-10-16(14)24-20/h1-4,7-10H,5-6,11-12H2.
What are the key properties of 2-[4-(3-oxo-1,2-benzoselenazol-2-yl)butyl]-1,2-benzoselenazol-3-one?
2-[4-(3-oxo-1,2-benzoselenazol-2-yl)butyl]-1,2-benzoselenazol-3-one has a molecular weight of 450.26 g/mol, XLogP of 1.91, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-(3-oxo-1,2-benzoselenazol-2-yl)butyl]-1,2-benzoselenazol-3-one is sourced from PubChem (CID 46911402), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).