C19H20FN2OS+ — CID 4691141
1-benzyl-2-(4-fluorophenyl)-3,5,6,7-tetrahydroimidazo[2,1-b][1,3]thiazin-4-ium-2-ol (PubChem CID 4691141) has the molecular formula C19H20FN2OS+ and a molecular weight of 343.45 g/mol. Its IUPAC name is 1-benzyl-2-(4-fluorophenyl)-3,5,6,7-tetrahydroimidazo[2,1-b][1,3]thiazin-4-ium-2-ol.
| Compound Name | 1-benzyl-2-(4-fluorophenyl)-3,5,6,7-tetrahydroimidazo[2,1-b][1,3]thiazin-4-ium-2-ol |
|---|---|
| PubChem CID | 4691141 |
| Molecular Formula | C19H20FN2OS+ |
| Molecular Weight | 343.45 g/mol |
| Exact Mass | 343.13 |
| IUPAC Name | 1-benzyl-2-(4-fluorophenyl)-3,5,6,7-tetrahydroimidazo[2,1-b][1,3]thiazin-4-ium-2-ol |
| SMILES | OC1(c2ccc(F)cc2)C[N+]2=C(SCCC2)N1Cc1ccccc1 |
| InChI | InChI=1S/C19H20FN2OS/c20-17-9-7-16(8-10-17)19(23)14-21-11-4-12-24-18(21)22(19)13-15-5-2-1-3-6-15/h1-3,5-10,23H,4,11-14H2/q+1 |
| InChIKey | INRRFHYQVISBNN-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 26.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.45 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|