C16H24N3O2S+ — CID 4691155
2-[(4-methoxyphenyl)methylsulfanyl]-N'-(1-methyl-1,2,3,6-tetrahydropyridin-1-ium-4-yl)acetohydrazide (PubChem CID 4691155) has the molecular formula C16H24N3O2S+ and a molecular weight of 322.45 g/mol. Its IUPAC name is 2-[(4-methoxyphenyl)methylsulfanyl]-N'-(1-methyl-1,2,3,6-tetrahydropyridin-1-ium-4-yl)acetohydrazide.
| Compound Name | 2-[(4-methoxyphenyl)methylsulfanyl]-N'-(1-methyl-1,2,3,6-tetrahydropyridin-1-ium-4-yl)acetohydrazide |
|---|---|
| PubChem CID | 4691155 |
| Molecular Formula | C16H24N3O2S+ |
| Molecular Weight | 322.45 g/mol |
| Exact Mass | 322.16 |
| IUPAC Name | 2-[(4-methoxyphenyl)methylsulfanyl]-N'-(1-methyl-1,2,3,6-tetrahydropyridin-1-ium-4-yl)acetohydrazide |
| SMILES | COc1ccc(CSCC(=O)NNC2=CC[NH+](C)CC2)cc1 |
| InChI | InChI=1S/C16H23N3O2S/c1-19-9-7-14(8-10-19)17-18-16(20)12-22-11-13-3-5-15(21-2)6-4-13/h3-7,17H,8-12H2,1-2H3,(H,18,20)/p+1 |
| InChIKey | WFBDRGPEJUDOAW-UHFFFAOYSA-O |
| XLogP | 0.35 |
| TPSA | 54.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.45 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|