About 7-benzyl-2,7-diazaspiro[4.5]decane
7-benzyl-2,7-diazaspiro[4.5]decane (PubChem CID 46911906) has the molecular formula C15H22N2
and a molecular weight of 230.36 g/mol. Its IUPAC name is 7-benzyl-2,7-diazaspiro[4.5]decane.
Molecular Properties
| Compound Name | 7-benzyl-2,7-diazaspiro[4.5]decane |
| PubChem CID | 46911906 |
| Molecular Formula | C15H22N2 |
| Molecular Weight | 230.36 g/mol |
| Exact Mass | 230.18 |
| IUPAC Name | 7-benzyl-2,7-diazaspiro[4.5]decane |
| SMILES | c1ccc(CN2CCCC3(CCNC3)C2)cc1 |
| InChI | InChI=1S/C15H22N2/c1-2-5-14(6-3-1)11-17-10-4-7-15(13-17)8-9-16-12-15/h1-3,5-6,16H,4,7-13H2 |
| InChIKey | OFLZQYXCNCHXGP-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 230.36 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 7-benzyl-2,7-diazaspiro[4.5]decane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-benzyl-2,7-diazaspiro[4.5]decane?
The IUPAC name of 7-benzyl-2,7-diazaspiro[4.5]decane (CID 46911906) is 7-benzyl-2,7-diazaspiro[4.5]decane.
What is the SMILES notation for 7-benzyl-2,7-diazaspiro[4.5]decane?
The canonical SMILES for 7-benzyl-2,7-diazaspiro[4.5]decane is c1ccc(CN2CCCC3(CCNC3)C2)cc1.
What is the InChIKey of 7-benzyl-2,7-diazaspiro[4.5]decane?
The InChIKey is OFLZQYXCNCHXGP-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H22N2/c1-2-5-14(6-3-1)11-17-10-4-7-15(13-17)8-9-16-12-15/h1-3,5-6,16H,4,7-13H2.
What are the key properties of 7-benzyl-2,7-diazaspiro[4.5]decane?
7-benzyl-2,7-diazaspiro[4.5]decane has a molecular weight of 230.36 g/mol, XLogP of 2.26, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 7-benzyl-2,7-diazaspiro[4.5]decane is sourced from PubChem (CID 46911906), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).