C29H27BF2N2O2 — CID 46912118
2,2-difluoro-8-hex-5-ynyl-4,12-bis(4-methoxyphenyl)-3-aza-1-azonia-2-boranuidatricyclo[7.3.0.03,7]dodeca-1(12),4,6,8,10-pentaene (PubChem CID 46912118) has the molecular formula C29H27BF2N2O2 and a molecular weight of 484.36 g/mol. Its IUPAC name is 2,2-difluoro-8-hex-5-ynyl-4,12-bis(4-methoxyphenyl)-3-aza-1-azonia-2-boranuidatricyclo[7.3.0.03,7]dodeca-1(12),4,6,8,10-pentaene.
| Compound Name | 2,2-difluoro-8-hex-5-ynyl-4,12-bis(4-methoxyphenyl)-3-aza-1-azonia-2-boranuidatricyclo[7.3.0.03,7]dodeca-1(12),4,6,8,10-pentaene |
|---|---|
| PubChem CID | 46912118 |
| Molecular Formula | C29H27BF2N2O2 |
| Molecular Weight | 484.36 g/mol |
| Exact Mass | 484.21 |
| IUPAC Name | 2,2-difluoro-8-hex-5-ynyl-4,12-bis(4-methoxyphenyl)-3-aza-1-azonia-2-boranuidatricyclo[7.3.0.03,7]dodeca-1(12),4,6,8,10-pentaene |
| SMILES | C#CCCCCC1=C2C=CC(c3ccc(OC)cc3)=[N+]2[B-](F)(F)n2c1ccc2-c1ccc(OC)cc1 |
| InChI | InChI=1S/C29H27BF2N2O2/c1-4-5-6-7-8-25-28-19-17-26(21-9-13-23(35-2)14-10-21)33(28)30(31,32)34-27(18-20-29(25)34)22-11-15-24(36-3)16-12-22/h1,9-20H,5-8H2,2-3H3 |
| InChIKey | WRBMLPSGDBTECU-UHFFFAOYSA-N |
| XLogP | 6.38 |
| TPSA | 26.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.36 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|