C19H23BF2N2 — CID 46912123
2,2-difluoro-8-hex-5-ynyl-4,6,10,12-tetramethyl-3-aza-1-azonia-2-boranuidatricyclo[7.3.0.03,7]dodeca-1(12),4,6,8,10-pentaene (PubChem CID 46912123) has the molecular formula C19H23BF2N2 and a molecular weight of 328.22 g/mol. Its IUPAC name is 2,2-difluoro-8-hex-5-ynyl-4,6,10,12-tetramethyl-3-aza-1-azonia-2-boranuidatricyclo[7.3.0.03,7]dodeca-1(12),4,6,8,10-pentaene.
| Compound Name | 2,2-difluoro-8-hex-5-ynyl-4,6,10,12-tetramethyl-3-aza-1-azonia-2-boranuidatricyclo[7.3.0.03,7]dodeca-1(12),4,6,8,10-pentaene |
|---|---|
| PubChem CID | 46912123 |
| Molecular Formula | C19H23BF2N2 |
| Molecular Weight | 328.22 g/mol |
| Exact Mass | 328.19 |
| IUPAC Name | 2,2-difluoro-8-hex-5-ynyl-4,6,10,12-tetramethyl-3-aza-1-azonia-2-boranuidatricyclo[7.3.0.03,7]dodeca-1(12),4,6,8,10-pentaene |
| SMILES | C#CCCCCC1=C2C(C)=CC(C)=[N+]2[B-](F)(F)n2c(C)cc(C)c21 |
| InChI | InChI=1S/C19H23BF2N2/c1-6-7-8-9-10-17-18-13(2)11-15(4)23(18)20(21,22)24-16(5)12-14(3)19(17)24/h1,11-12H,7-10H2,2-5H3 |
| InChIKey | IDBLRLJMZZRFGG-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 7.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.22 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|