C16H14O2S2 — CID 46912200
3-(2,5-dimethylphenyl)sulfanyl-1-benzothiophene 1,1-dioxide (PubChem CID 46912200) has the molecular formula C16H14O2S2 and a molecular weight of 302.42 g/mol. Its IUPAC name is 3-(2,5-dimethylphenyl)sulfanyl-1-benzothiophene 1,1-dioxide.
| Compound Name | 3-(2,5-dimethylphenyl)sulfanyl-1-benzothiophene 1,1-dioxide |
|---|---|
| PubChem CID | 46912200 |
| Molecular Formula | C16H14O2S2 |
| Molecular Weight | 302.42 g/mol |
| Exact Mass | 302.04 |
| IUPAC Name | 3-(2,5-dimethylphenyl)sulfanyl-1-benzothiophene 1,1-dioxide |
| SMILES | Cc1ccc(C)c(SC2=CS(=O)(=O)c3ccccc32)c1 |
| InChI | InChI=1S/C16H14O2S2/c1-11-7-8-12(2)14(9-11)19-15-10-20(17,18)16-6-4-3-5-13(15)16/h3-10H,1-2H3 |
| InChIKey | XTURDNIZLXFYTK-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.42 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |