About 2-imidazol-1-ylethyl (2R)-2-[[2-(4-fluorophenyl)acetyl]amino]-3-(1H-indol-3-yl)propanoate
2-imidazol-1-ylethyl (2R)-2-[[2-(4-fluorophenyl)acetyl]amino]-3-(1H-indol-3-yl)propanoate (PubChem CID 46912565) has the molecular formula C24H23FN4O3
and a molecular weight of 434.47 g/mol. Its IUPAC name is 2-imidazol-1-ylethyl (2R)-2-[[2-(4-fluorophenyl)acetyl]amino]-3-(1H-indol-3-yl)propanoate.
Molecular Properties
| Compound Name | 2-imidazol-1-ylethyl (2R)-2-[[2-(4-fluorophenyl)acetyl]amino]-3-(1H-indol-3-yl)propanoate |
| PubChem CID | 46912565 |
| Molecular Formula | C24H23FN4O3 |
| Molecular Weight | 434.47 g/mol |
| Exact Mass | 434.18 |
| IUPAC Name | 2-imidazol-1-ylethyl (2R)-2-[[2-(4-fluorophenyl)acetyl]amino]-3-(1H-indol-3-yl)propanoate |
| SMILES | O=C(Cc1ccc(F)cc1)N[C@H](Cc1c[nH]c2ccccc12)C(=O)OCCn1ccnc1 |
| InChI | InChI=1S/C24H23FN4O3/c25-19-7-5-17(6-8-19)13-23(30)28-22(24(31)32-12-11-29-10-9-26-16-29)14-18-15-27-21-4-2-1-3-20(18)21/h1-10,15-16,22,27H,11-14H2,(H,28,30)/t22-/m1/s1 |
| InChIKey | TYTLIODAEIYDKX-JOCHJYFZSA-N |
| XLogP | 3.02 |
| TPSA | 89.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 434.47 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-imidazol-1-ylethyl (2R)-2-[[2-(4-fluorophenyl)acetyl]amino]-3-(1H-indol-3-yl)propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-imidazol-1-ylethyl (2R)-2-[[2-(4-fluorophenyl)acetyl]amino]-3-(1H-indol-3-yl)propanoate?
The IUPAC name of 2-imidazol-1-ylethyl (2R)-2-[[2-(4-fluorophenyl)acetyl]amino]-3-(1H-indol-3-yl)propanoate (CID 46912565) is 2-imidazol-1-ylethyl (2R)-2-[[2-(4-fluorophenyl)acetyl]amino]-3-(1H-indol-3-yl)propanoate.
What is the SMILES notation for 2-imidazol-1-ylethyl (2R)-2-[[2-(4-fluorophenyl)acetyl]amino]-3-(1H-indol-3-yl)propanoate?
The canonical SMILES for 2-imidazol-1-ylethyl (2R)-2-[[2-(4-fluorophenyl)acetyl]amino]-3-(1H-indol-3-yl)propanoate is O=C(Cc1ccc(F)cc1)N[C@H](Cc1c[nH]c2ccccc12)C(=O)OCCn1ccnc1.
What is the InChIKey of 2-imidazol-1-ylethyl (2R)-2-[[2-(4-fluorophenyl)acetyl]amino]-3-(1H-indol-3-yl)propanoate?
The InChIKey is TYTLIODAEIYDKX-JOCHJYFZSA-N. The full InChI is InChI=1S/C24H23FN4O3/c25-19-7-5-17(6-8-19)13-23(30)28-22(24(31)32-12-11-29-10-9-26-16-29)14-18-15-27-21-4-2-1-3-20(18)21/h1-10,15-16,22,27H,11-14H2,(H,28,30)/t22-/m1/s1.
What are the key properties of 2-imidazol-1-ylethyl (2R)-2-[[2-(4-fluorophenyl)acetyl]amino]-3-(1H-indol-3-yl)propanoate?
2-imidazol-1-ylethyl (2R)-2-[[2-(4-fluorophenyl)acetyl]amino]-3-(1H-indol-3-yl)propanoate has a molecular weight of 434.47 g/mol, XLogP of 3.02, 9 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-imidazol-1-ylethyl (2R)-2-[[2-(4-fluorophenyl)acetyl]amino]-3-(1H-indol-3-yl)propanoate is sourced from PubChem (CID 46912565), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).