About [2-(4-cyanophenyl)-1,3-dioxoisoindol-5-yl] 3-(6-amino-3-pyridinyl)propanoate
[2-(4-cyanophenyl)-1,3-dioxoisoindol-5-yl] 3-(6-amino-3-pyridinyl)propanoate (PubChem CID 46913319) has the molecular formula C23H16N4O4
and a molecular weight of 412.41 g/mol. Its IUPAC name is [2-(4-cyanophenyl)-1,3-dioxoisoindol-5-yl] 3-(6-amino-3-pyridinyl)propanoate.
Molecular Properties
| Compound Name | [2-(4-cyanophenyl)-1,3-dioxoisoindol-5-yl] 3-(6-amino-3-pyridinyl)propanoate |
| PubChem CID | 46913319 |
| Molecular Formula | C23H16N4O4 |
| Molecular Weight | 412.41 g/mol |
| Exact Mass | 412.12 |
| IUPAC Name | [2-(4-cyanophenyl)-1,3-dioxoisoindol-5-yl] 3-(6-amino-3-pyridinyl)propanoate |
| SMILES | N#Cc1ccc(N2C(=O)c3ccc(OC(=O)CCc4ccc(N)nc4)cc3C2=O)cc1 |
| InChI | InChI=1S/C23H16N4O4/c24-12-14-1-5-16(6-2-14)27-22(29)18-8-7-17(11-19(18)23(27)30)31-21(28)10-4-15-3-9-20(25)26-13-15/h1-3,5-9,11,13H,4,10H2,(H2,25,26) |
| InChIKey | GQVZNQNDMFDCKG-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 126.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 412.41 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze [2-(4-cyanophenyl)-1,3-dioxoisoindol-5-yl] 3-(6-amino-3-pyridinyl)propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(4-cyanophenyl)-1,3-dioxoisoindol-5-yl] 3-(6-amino-3-pyridinyl)propanoate?
The IUPAC name of [2-(4-cyanophenyl)-1,3-dioxoisoindol-5-yl] 3-(6-amino-3-pyridinyl)propanoate (CID 46913319) is [2-(4-cyanophenyl)-1,3-dioxoisoindol-5-yl] 3-(6-amino-3-pyridinyl)propanoate.
What is the SMILES notation for [2-(4-cyanophenyl)-1,3-dioxoisoindol-5-yl] 3-(6-amino-3-pyridinyl)propanoate?
The canonical SMILES for [2-(4-cyanophenyl)-1,3-dioxoisoindol-5-yl] 3-(6-amino-3-pyridinyl)propanoate is N#Cc1ccc(N2C(=O)c3ccc(OC(=O)CCc4ccc(N)nc4)cc3C2=O)cc1.
What is the InChIKey of [2-(4-cyanophenyl)-1,3-dioxoisoindol-5-yl] 3-(6-amino-3-pyridinyl)propanoate?
The InChIKey is GQVZNQNDMFDCKG-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H16N4O4/c24-12-14-1-5-16(6-2-14)27-22(29)18-8-7-17(11-19(18)23(27)30)31-21(28)10-4-15-3-9-20(25)26-13-15/h1-3,5-9,11,13H,4,10H2,(H2,25,26).
What are the key properties of [2-(4-cyanophenyl)-1,3-dioxoisoindol-5-yl] 3-(6-amino-3-pyridinyl)propanoate?
[2-(4-cyanophenyl)-1,3-dioxoisoindol-5-yl] 3-(6-amino-3-pyridinyl)propanoate has a molecular weight of 412.41 g/mol, XLogP of 2.87, 5 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(4-cyanophenyl)-1,3-dioxoisoindol-5-yl] 3-(6-amino-3-pyridinyl)propanoate is sourced from PubChem (CID 46913319), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).