About N-[5-(3,5-difluorophenyl)-2-pyridinyl]-4-(2-oxopyrrolidin-1-yl)cyclohexane-1-carboxamide
N-[5-(3,5-difluorophenyl)-2-pyridinyl]-4-(2-oxopyrrolidin-1-yl)cyclohexane-1-carboxamide (PubChem CID 46913408) has the molecular formula C22H23F2N3O2
and a molecular weight of 399.44 g/mol. Its IUPAC name is N-[5-(3,5-difluorophenyl)-2-pyridinyl]-4-(2-oxopyrrolidin-1-yl)cyclohexane-1-carboxamide.
Molecular Properties
| Compound Name | N-[5-(3,5-difluorophenyl)-2-pyridinyl]-4-(2-oxopyrrolidin-1-yl)cyclohexane-1-carboxamide |
| PubChem CID | 46913408 |
| Molecular Formula | C22H23F2N3O2 |
| Molecular Weight | 399.44 g/mol |
| Exact Mass | 399.18 |
| IUPAC Name | N-[5-(3,5-difluorophenyl)-2-pyridinyl]-4-(2-oxopyrrolidin-1-yl)cyclohexane-1-carboxamide |
| SMILES | O=C(Nc1ccc(-c2cc(F)cc(F)c2)cn1)C1CCC(N2CCCC2=O)CC1 |
| InChI | InChI=1S/C22H23F2N3O2/c23-17-10-16(11-18(24)12-17)15-5-8-20(25-13-15)26-22(29)14-3-6-19(7-4-14)27-9-1-2-21(27)28/h5,8,10-14,19H,1-4,6-7,9H2,(H,25,26,29) |
| InChIKey | VJTLKAQSSWSCFX-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 399.44 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-[5-(3,5-difluorophenyl)-2-pyridinyl]-4-(2-oxopyrrolidin-1-yl)cyclohexane-1-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[5-(3,5-difluorophenyl)-2-pyridinyl]-4-(2-oxopyrrolidin-1-yl)cyclohexane-1-carboxamide?
The IUPAC name of N-[5-(3,5-difluorophenyl)-2-pyridinyl]-4-(2-oxopyrrolidin-1-yl)cyclohexane-1-carboxamide (CID 46913408) is N-[5-(3,5-difluorophenyl)-2-pyridinyl]-4-(2-oxopyrrolidin-1-yl)cyclohexane-1-carboxamide.
What is the SMILES notation for N-[5-(3,5-difluorophenyl)-2-pyridinyl]-4-(2-oxopyrrolidin-1-yl)cyclohexane-1-carboxamide?
The canonical SMILES for N-[5-(3,5-difluorophenyl)-2-pyridinyl]-4-(2-oxopyrrolidin-1-yl)cyclohexane-1-carboxamide is O=C(Nc1ccc(-c2cc(F)cc(F)c2)cn1)C1CCC(N2CCCC2=O)CC1.
What is the InChIKey of N-[5-(3,5-difluorophenyl)-2-pyridinyl]-4-(2-oxopyrrolidin-1-yl)cyclohexane-1-carboxamide?
The InChIKey is VJTLKAQSSWSCFX-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H23F2N3O2/c23-17-10-16(11-18(24)12-17)15-5-8-20(25-13-15)26-22(29)14-3-6-19(7-4-14)27-9-1-2-21(27)28/h5,8,10-14,19H,1-4,6-7,9H2,(H,25,26,29).
What are the key properties of N-[5-(3,5-difluorophenyl)-2-pyridinyl]-4-(2-oxopyrrolidin-1-yl)cyclohexane-1-carboxamide?
N-[5-(3,5-difluorophenyl)-2-pyridinyl]-4-(2-oxopyrrolidin-1-yl)cyclohexane-1-carboxamide has a molecular weight of 399.44 g/mol, XLogP of 4.15, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[5-(3,5-difluorophenyl)-2-pyridinyl]-4-(2-oxopyrrolidin-1-yl)cyclohexane-1-carboxamide is sourced from PubChem (CID 46913408), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).