C22H23N9O3S — CID 46913624
4-[(2,4-diaminopteridin-6-yl)methylamino]-N-[2-(4-sulfamoylphenyl)ethyl]benzamide (PubChem CID 46913624) has the molecular formula C22H23N9O3S and a molecular weight of 493.55 g/mol. Its IUPAC name is 4-[(2,4-diaminopteridin-6-yl)methylamino]-N-[2-(4-sulfamoylphenyl)ethyl]benzamide.
| Compound Name | 4-[(2,4-diaminopteridin-6-yl)methylamino]-N-[2-(4-sulfamoylphenyl)ethyl]benzamide |
|---|---|
| PubChem CID | 46913624 |
| Molecular Formula | C22H23N9O3S |
| Molecular Weight | 493.55 g/mol |
| Exact Mass | 493.16 |
| IUPAC Name | 4-[(2,4-diaminopteridin-6-yl)methylamino]-N-[2-(4-sulfamoylphenyl)ethyl]benzamide |
| SMILES | Nc1nc(N)c2nc(CNc3ccc(C(=O)NCCc4ccc(S(N)(=O)=O)cc4)cc3)cnc2n1 |
| InChI | InChI=1S/C22H23N9O3S/c23-19-18-20(31-22(24)30-19)28-12-16(29-18)11-27-15-5-3-14(4-6-15)21(32)26-10-9-13-1-7-17(8-2-13)35(25,33)34/h1-8,12,27H,9-11H2,(H,26,32)(H2,25,33,34)(H4,23,24,28,30,31) |
| InChIKey | KBKPMXIFQOBRNL-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 204.89 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.55 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |