About N'-(5-bromo-2-cyanopyrimidin-4-yl)-2-(2,6-difluorophenyl)-N'-(2-methylpropyl)acetohydrazide
N'-(5-bromo-2-cyanopyrimidin-4-yl)-2-(2,6-difluorophenyl)-N'-(2-methylpropyl)acetohydrazide (PubChem CID 46913916) has the molecular formula C17H16BrF2N5O
and a molecular weight of 424.25 g/mol. Its IUPAC name is N'-(5-bromo-2-cyanopyrimidin-4-yl)-2-(2,6-difluorophenyl)-N'-(2-methylpropyl)acetohydrazide.
Molecular Properties
| Compound Name | N'-(5-bromo-2-cyanopyrimidin-4-yl)-2-(2,6-difluorophenyl)-N'-(2-methylpropyl)acetohydrazide |
| PubChem CID | 46913916 |
| Molecular Formula | C17H16BrF2N5O |
| Molecular Weight | 424.25 g/mol |
| Exact Mass | 423.05 |
| IUPAC Name | N'-(5-bromo-2-cyanopyrimidin-4-yl)-2-(2,6-difluorophenyl)-N'-(2-methylpropyl)acetohydrazide |
| SMILES | CC(C)CN(NC(=O)Cc1c(F)cccc1F)c1nc(C#N)ncc1Br |
| InChI | InChI=1S/C17H16BrF2N5O/c1-10(2)9-25(17-12(18)8-22-15(7-21)23-17)24-16(26)6-11-13(19)4-3-5-14(11)20/h3-5,8,10H,6,9H2,1-2H3,(H,24,26) |
| InChIKey | VNYANFCXOWMRJY-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 81.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 424.25 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N'-(5-bromo-2-cyanopyrimidin-4-yl)-2-(2,6-difluorophenyl)-N'-(2-methylpropyl)acetohydrazide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-(5-bromo-2-cyanopyrimidin-4-yl)-2-(2,6-difluorophenyl)-N'-(2-methylpropyl)acetohydrazide?
The IUPAC name of N'-(5-bromo-2-cyanopyrimidin-4-yl)-2-(2,6-difluorophenyl)-N'-(2-methylpropyl)acetohydrazide (CID 46913916) is N'-(5-bromo-2-cyanopyrimidin-4-yl)-2-(2,6-difluorophenyl)-N'-(2-methylpropyl)acetohydrazide.
What is the SMILES notation for N'-(5-bromo-2-cyanopyrimidin-4-yl)-2-(2,6-difluorophenyl)-N'-(2-methylpropyl)acetohydrazide?
The canonical SMILES for N'-(5-bromo-2-cyanopyrimidin-4-yl)-2-(2,6-difluorophenyl)-N'-(2-methylpropyl)acetohydrazide is CC(C)CN(NC(=O)Cc1c(F)cccc1F)c1nc(C#N)ncc1Br.
What is the InChIKey of N'-(5-bromo-2-cyanopyrimidin-4-yl)-2-(2,6-difluorophenyl)-N'-(2-methylpropyl)acetohydrazide?
The InChIKey is VNYANFCXOWMRJY-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H16BrF2N5O/c1-10(2)9-25(17-12(18)8-22-15(7-21)23-17)24-16(26)6-11-13(19)4-3-5-14(11)20/h3-5,8,10H,6,9H2,1-2H3,(H,24,26).
What are the key properties of N'-(5-bromo-2-cyanopyrimidin-4-yl)-2-(2,6-difluorophenyl)-N'-(2-methylpropyl)acetohydrazide?
N'-(5-bromo-2-cyanopyrimidin-4-yl)-2-(2,6-difluorophenyl)-N'-(2-methylpropyl)acetohydrazide has a molecular weight of 424.25 g/mol, XLogP of 3.13, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N'-(5-bromo-2-cyanopyrimidin-4-yl)-2-(2,6-difluorophenyl)-N'-(2-methylpropyl)acetohydrazide is sourced from PubChem (CID 46913916), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).