C20H24BrN5O — CID 46913918
N'-(5-bromo-2-cyanopyrimidin-4-yl)-N'-(2-methylpropyl)-2-(2,4,6-trimethylphenyl)acetohydrazide (PubChem CID 46913918) has the molecular formula C20H24BrN5O and a molecular weight of 430.35 g/mol. Its IUPAC name is N'-(5-bromo-2-cyanopyrimidin-4-yl)-N'-(2-methylpropyl)-2-(2,4,6-trimethylphenyl)acetohydrazide.
| Compound Name | N'-(5-bromo-2-cyanopyrimidin-4-yl)-N'-(2-methylpropyl)-2-(2,4,6-trimethylphenyl)acetohydrazide |
|---|---|
| PubChem CID | 46913918 |
| Molecular Formula | C20H24BrN5O |
| Molecular Weight | 430.35 g/mol |
| Exact Mass | 429.12 |
| IUPAC Name | N'-(5-bromo-2-cyanopyrimidin-4-yl)-N'-(2-methylpropyl)-2-(2,4,6-trimethylphenyl)acetohydrazide |
| SMILES | Cc1cc(C)c(CC(=O)NN(CC(C)C)c2nc(C#N)ncc2Br)c(C)c1 |
| InChI | InChI=1S/C20H24BrN5O/c1-12(2)11-26(20-17(21)10-23-18(9-22)24-20)25-19(27)8-16-14(4)6-13(3)7-15(16)5/h6-7,10,12H,8,11H2,1-5H3,(H,25,27) |
| InChIKey | VUEXRRPFSOLGME-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 81.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.35 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|