About tert-butyl 5-cyano-4-(4-fluorophenyl)-2,6-dimethyl-1,4-dihydropyridine-3-carboxylate
tert-butyl 5-cyano-4-(4-fluorophenyl)-2,6-dimethyl-1,4-dihydropyridine-3-carboxylate (PubChem CID 46914165) has the molecular formula C19H21FN2O2
and a molecular weight of 328.39 g/mol. Its IUPAC name is tert-butyl 5-cyano-4-(4-fluorophenyl)-2,6-dimethyl-1,4-dihydropyridine-3-carboxylate.
Molecular Properties
| Compound Name | tert-butyl 5-cyano-4-(4-fluorophenyl)-2,6-dimethyl-1,4-dihydropyridine-3-carboxylate |
| PubChem CID | 46914165 |
| Molecular Formula | C19H21FN2O2 |
| Molecular Weight | 328.39 g/mol |
| Exact Mass | 328.16 |
| IUPAC Name | tert-butyl 5-cyano-4-(4-fluorophenyl)-2,6-dimethyl-1,4-dihydropyridine-3-carboxylate |
| SMILES | CC1=C(C#N)C(c2ccc(F)cc2)C(C(=O)OC(C)(C)C)=C(C)N1 |
| InChI | InChI=1S/C19H21FN2O2/c1-11-15(10-21)17(13-6-8-14(20)9-7-13)16(12(2)22-11)18(23)24-19(3,4)5/h6-9,17,22H,1-5H3 |
| InChIKey | ZDGXHVBHHYGNPD-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 62.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 328.39 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze tert-butyl 5-cyano-4-(4-fluorophenyl)-2,6-dimethyl-1,4-dihydropyridine-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl 5-cyano-4-(4-fluorophenyl)-2,6-dimethyl-1,4-dihydropyridine-3-carboxylate?
The IUPAC name of tert-butyl 5-cyano-4-(4-fluorophenyl)-2,6-dimethyl-1,4-dihydropyridine-3-carboxylate (CID 46914165) is tert-butyl 5-cyano-4-(4-fluorophenyl)-2,6-dimethyl-1,4-dihydropyridine-3-carboxylate.
What is the SMILES notation for tert-butyl 5-cyano-4-(4-fluorophenyl)-2,6-dimethyl-1,4-dihydropyridine-3-carboxylate?
The canonical SMILES for tert-butyl 5-cyano-4-(4-fluorophenyl)-2,6-dimethyl-1,4-dihydropyridine-3-carboxylate is CC1=C(C#N)C(c2ccc(F)cc2)C(C(=O)OC(C)(C)C)=C(C)N1.
What is the InChIKey of tert-butyl 5-cyano-4-(4-fluorophenyl)-2,6-dimethyl-1,4-dihydropyridine-3-carboxylate?
The InChIKey is ZDGXHVBHHYGNPD-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H21FN2O2/c1-11-15(10-21)17(13-6-8-14(20)9-7-13)16(12(2)22-11)18(23)24-19(3,4)5/h6-9,17,22H,1-5H3.
What are the key properties of tert-butyl 5-cyano-4-(4-fluorophenyl)-2,6-dimethyl-1,4-dihydropyridine-3-carboxylate?
tert-butyl 5-cyano-4-(4-fluorophenyl)-2,6-dimethyl-1,4-dihydropyridine-3-carboxylate has a molecular weight of 328.39 g/mol, XLogP of 3.93, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl 5-cyano-4-(4-fluorophenyl)-2,6-dimethyl-1,4-dihydropyridine-3-carboxylate is sourced from PubChem (CID 46914165), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).