C34H63NO5Si2 — CID 46914556
2-trimethylsilylethyl (2R,4aS,8aS)-2-hexyl-8a-[(E)-3-methoxy-3-oxoprop-1-enyl]-4-tri(propan-2-yl)silyloxy-2,4a,5,6,7,8-hexahydroquinoline-1-carboxylate (PubChem CID 46914556) has the molecular formula C34H63NO5Si2 and a molecular weight of 622.05 g/mol. Its IUPAC name is 2-trimethylsilylethyl (2R,4aS,8aS)-2-hexyl-8a-[(E)-3-methoxy-3-oxoprop-1-enyl]-4-tri(propan-2-yl)silyloxy-2,4a,5,6,7,8-hexahydroquinoline-1-carboxylate.
| Compound Name | 2-trimethylsilylethyl (2R,4aS,8aS)-2-hexyl-8a-[(E)-3-methoxy-3-oxoprop-1-enyl]-4-tri(propan-2-yl)silyloxy-2,4a,5,6,7,8-hexahydroquinoline-1-carboxylate |
|---|---|
| PubChem CID | 46914556 |
| Molecular Formula | C34H63NO5Si2 |
| Molecular Weight | 622.05 g/mol |
| Exact Mass | 621.42 |
| IUPAC Name | 2-trimethylsilylethyl (2R,4aS,8aS)-2-hexyl-8a-[(E)-3-methoxy-3-oxoprop-1-enyl]-4-tri(propan-2-yl)silyloxy-2,4a,5,6,7,8-hexahydroquinoline-1-carboxylate |
| SMILES | CCCCCC[C@@H]1C=C(O[Si](C(C)C)(C(C)C)C(C)C)[C@H]2CCCC[C@@]2(/C=C/C(=O)OC)N1C(=O)OCC[Si](C)(C)C |
| InChI | InChI=1S/C34H63NO5Si2/c1-12-13-14-15-18-29-25-31(40-42(26(2)3,27(4)5)28(6)7)30-19-16-17-21-34(30,22-20-32(36)38-8)35(29)33(37)39-23-24-41(9,10)11/h20,22,25-30H,12-19,21,23-24H2,1-11H3/b22-20+/t29-,30-,34+/m1/s1 |
| InChIKey | NKNKPDGOCNXVQB-KGUDVGBDSA-N |
| XLogP | 9.85 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 622.05 |
| LogP ≤ 5 | 9.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|