C27H27F2NO5 — CID 46914753
3-[4-(3-fluorophenyl)-1-(4-fluorophenyl)-3H-2-benzofuran-1-yl]-N,N-dimethylpropan-1-amine;oxalic acid (PubChem CID 46914753) has the molecular formula C27H27F2NO5 and a molecular weight of 483.51 g/mol. Its IUPAC name is 3-[4-(3-fluorophenyl)-1-(4-fluorophenyl)-3H-2-benzofuran-1-yl]-N,N-dimethylpropan-1-amine;oxalic acid.
| Compound Name | 3-[4-(3-fluorophenyl)-1-(4-fluorophenyl)-3H-2-benzofuran-1-yl]-N,N-dimethylpropan-1-amine;oxalic acid |
|---|---|
| PubChem CID | 46914753 |
| Molecular Formula | C27H27F2NO5 |
| Molecular Weight | 483.51 g/mol |
| Exact Mass | 483.19 |
| IUPAC Name | 3-[4-(3-fluorophenyl)-1-(4-fluorophenyl)-3H-2-benzofuran-1-yl]-N,N-dimethylpropan-1-amine;oxalic acid |
| SMILES | CN(C)CCCC1(c2ccc(F)cc2)OCc2c(-c3cccc(F)c3)cccc21.O=C(O)C(=O)O |
| InChI | InChI=1S/C25H25F2NO.C2H2O4/c1-28(2)15-5-14-25(19-10-12-20(26)13-11-19)24-9-4-8-22(23(24)17-29-25)18-6-3-7-21(27)16-18;3-1(4)2(5)6/h3-4,6-13,16H,5,14-15,17H2,1-2H3;(H,3,4)(H,5,6) |
| InChIKey | TWZGNXQRSLOJQQ-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 87.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.51 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|