About 2-acetamido-N,4-dimethylpentanamide
2-acetamido-N,4-dimethylpentanamide (PubChem CID 4691503) has the molecular formula C9H18N2O2
and a molecular weight of 186.25 g/mol. Its IUPAC name is 2-acetamido-N,4-dimethylpentanamide.
Molecular Properties
| Compound Name | 2-acetamido-N,4-dimethylpentanamide |
| PubChem CID | 4691503 |
| Molecular Formula | C9H18N2O2 |
| Molecular Weight | 186.25 g/mol |
| Exact Mass | 186.14 |
| IUPAC Name | 2-acetamido-N,4-dimethylpentanamide |
| SMILES | CNC(=O)C(CC(C)C)NC(C)=O |
| InChI | InChI=1S/C9H18N2O2/c1-6(2)5-8(9(13)10-4)11-7(3)12/h6,8H,5H2,1-4H3,(H,10,13)(H,11,12) |
| InChIKey | GFQFFCFJVLJXRY-UHFFFAOYSA-N |
| XLogP | 0.28 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 186.25 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-acetamido-N,4-dimethylpentanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-acetamido-N,4-dimethylpentanamide?
The IUPAC name of 2-acetamido-N,4-dimethylpentanamide (CID 4691503) is 2-acetamido-N,4-dimethylpentanamide.
What is the SMILES notation for 2-acetamido-N,4-dimethylpentanamide?
The canonical SMILES for 2-acetamido-N,4-dimethylpentanamide is CNC(=O)C(CC(C)C)NC(C)=O.
What is the InChIKey of 2-acetamido-N,4-dimethylpentanamide?
The InChIKey is GFQFFCFJVLJXRY-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H18N2O2/c1-6(2)5-8(9(13)10-4)11-7(3)12/h6,8H,5H2,1-4H3,(H,10,13)(H,11,12).
What are the key properties of 2-acetamido-N,4-dimethylpentanamide?
2-acetamido-N,4-dimethylpentanamide has a molecular weight of 186.25 g/mol, XLogP of 0.28, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-acetamido-N,4-dimethylpentanamide is sourced from PubChem (CID 4691503), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).